NPASS drugs

Drug Information

Drug ID:	NPD4111
Drug Name:	AIKO-150
Molecular Formula:	C20H25NO4
Canonical SMILES:	O[C@@H]1CC[C@@]2([C@@]34[C@H]1Oc1c4c(C[C@H]2N(CC3)CC2CC2)ccc1O)O
Standard InCHI:	"InChI=1S/C20H25NO4/c22-13-4-3-12-9-15-20(24)6-5-14(23)18-19(20,16(12)17(13)25-18)7-8-21(15)10-11-1-2-11/h3-4,11,14-15,18,22-24H,1-2,5-10H2/t14-,15-,18+,19+,20-/m1/s1"
Standard InCHIKey:	JLVNEHKORQFVQJ-PYIJOLGTSA-N
Max Developmental Stage:	Phase 1
Max Developmental Stage Source:	TTD

Structural Similarity Between NPASS Natural Products and NPD4111

Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.

Range	Similarity Score Range
0-0.1	75336
0.1-0.2	133298
0.2-0.3	3042
0.3-0.4	41
0.4-0.5	13
0.5-0.6	9
0.6-0.7	0
0.7-0.8	1
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similar Natural Products

High Similarity: Tc>=0.85; Intermediate Similarity: 0.7 <= Tc < 0.85; Remote Similarity: 0.5 <= Tc < 0.7

Similarity Level	Similarity Score	Natural Product ID
Intermediate Similarity	0.726	NPC611959
Remote Similarity	0.5974	NPC254045
Remote Similarity	0.5974	NPC201055
Remote Similarity	0.5974	NPC265000
Remote Similarity	0.5974	NPC64576
Remote Similarity	0.5974	NPC151470
Remote Similarity	0.5974	NPC603205
Remote Similarity	0.5974	NPC603486
Remote Similarity	0.5974	NPC611632
Remote Similarity	0.5385	NPC97086

Drug Structure

NPD4111 OpenBabel08211704332D 28 33 0 0 1 0 0 0 0 0999 V2000 3.4117 1.1372 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.4117 0.3047 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.0000 -2.4972 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.7210 -2.9134 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.7210 1.2488 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.0000 0.8325 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.0000 -0.8325 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.4419 -0.8325 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.7210 -1.2484 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.8582 0.7210 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.6907 0.7210 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.0000 -1.6646 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.4420 -2.4972 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.4419 0.8325 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 0.7210 -0.4163 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 -0.7210 -1.2484 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.4419 -1.6646 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.4419 0.0000 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 -0.7210 -0.4163 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 0.0000 -0.0000 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 1.4419 -0.0000 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 -2.1629 -2.9134 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -2.1629 1.2488 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 0.7210 0.4163 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -2.1417 -0.8325 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -2.3238 -3.7302 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.6546 0.5770 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 0.4879 1.2155 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 1 2 1 0 0 0 0 1 11 1 0 0 0 0 2 11 1 0 0 0 0 3 4 2 0 0 0 0 3 12 1 0 0 0 0 4 13 1 0 0 0 0 5 6 1 0 0 0 0 5 14 1 0 0 0 0 6 20 1 0 0 0 0 7 8 1 0 0 0 0 7 19 1 0 0 0 0 8 21 1 0 0 0 0 9 12 1 0 0 0 0 9 15 1 0 0 0 0 10 11 1 0 0 0 0 10 21 1 0 0 0 0 12 16 2 0 0 0 0 13 17 2 0 0 0 0 13 22 1 0 0 0 0 14 18 1 0 0 0 0 14 23 1 6 0 0 0 15 20 1 6 0 0 0 15 21 1 0 0 0 0 16 17 1 0 0 0 0 16 19 1 0 0 0 0 17 25 1 0 0 0 0 18 19 1 1 0 0 0 18 25 1 0 0 0 0 19 20 1 1 0 0 0 20 24 1 6 0 0 0 22 26 1 0 0 0 0 23 27 1 0 0 0 0 24 28 1 0 0 0 0 M END $$$$

External Identifiers

TTD	DIB015545
DrugBank
ChEMBL
IUPHAR/BPS
PharmaGKB
KEGG Drug
PubChem CID	0
ChEBI
CAS Number

Drug Properties

Molecular Weight	343.18
ALogP	-1.3512
MLogP	3.11
XLogP	0.194
HDA	5
HBD	3
Rotatable Bonds	5
TPSA	73.16
RO5 Violation	0