Drug Information| Drug ID:   | NPD4092 |
| Drug Name:   | Levomefolic Acid |
| Molecular Formula:   | C20H25N7O6 |
| Canonical SMILES:   | OC(=O)CC[C@@H](C(=O)O)NC(=O)c1ccc(cc1)NC[C@H]1CNc2c(N1C)c(O)nc(=N)[nH]2 |
| Standard InCHI:   | "InChI=1S/C20H25N7O6/c1-27-12(9-23-16-15(27)18(31)26-20(21)25-16)8-22-11-4-2-10(3-5-11)17(30)24-13(19(32)33)6-7-14(28)29/h2-5,12-13,22H,6-9H2,1H3,(H,24,30)(H,28,29)(H,32,33)(H4,21,23,25,26,31)/t12-,13-/m0/s1" |
| Standard InCHIKey:   | ZNOVTXRBGFNYRX-STQMWFEESA-N |
| Max Developmental Stage:   | Phase 4 |
| Max Developmental Stage Source:   | ChEMBL |
  Structural Similarity Between NPASS Natural Products and NPD4092Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.
  Similar Natural Products High Similarity: Tc>=0.85; Intermediate Similarity: 0.7 <= Tc < 0.85; Remote Similarity: 0.5 <= Tc < 0.7
| Similarity Level | Similarity Score | Natural Product ID |
|---|---|---|
| High Similarity | 1.0 | NPC99201 |
| High Similarity | 1.0 | NPC269681 |
| High Similarity | 1.0 | NPC14849 |
| Intermediate Similarity | 0.7011 | NPC248862 |
| Remote Similarity | 0.6667 | NPC611805 |
| Remote Similarity | 0.6292 | NPC328611 |
| Remote Similarity | 0.6022 | NPC131450 |
| Remote Similarity | 0.6022 | NPC150469 |
| Remote Similarity | 0.6022 | NPC182057 |
| Remote Similarity | 0.6022 | NPC86831 |
| Remote Similarity | 0.6022 | NPC147298 |
| Remote Similarity | 0.587 | NPC493894 |
| Remote Similarity | 0.5213 | NPC607357 |
| Remote Similarity | 0.5204 | NPC262143 |
| TTD   | |
| DrugBank   | DB11256 |
| ChEMBL   | CHEMBL1231574 |
| IUPHAR/BPS   | |
| PharmaGKB   | |
| KEGG Drug   | |
| PubChem CID   | 0 |
| ChEBI   | 15641 |
| CAS Number   | 31690-09-2 |
| Molecular Weight   | 459.19 |
| ALogP   | -2.9329 |
| MLogP   | 2.23 |
| XLogP   | 1.129 |
| HDA   | 13 |
| HBD   | 8 |
| Rotatable Bonds   | 14 |
| TPSA   | 199.47 |
| RO5 Violation   | 2 |