Drug Information| Drug ID:   | NPD4091 |
| Drug Name:   | Levomefolate Calcium |
| Molecular Formula:   | C20H25N7O6.Ca |
| Canonical SMILES:   | [O-]C(=O)CC[C@@H](C(=O)O)NC(=O)c1ccc(cc1)NC[C@H]1CNc2c(N1C)c([O-])nc(=N)[nH]2.[Ca+2] |
| Standard InCHI:   | "InChI=1S/C20H25N7O6.Ca/c1-27-12(9-23-16-15(27)18(31)26-20(21)25-16)8-22-11-4-2-10(3-5-11)17(30)24-13(19(32)33)6-7-14(28)29;/h2-5,12-13,22H,6-9H2,1H3,(H,24,30)(H,28,29)(H,32,33)(H4,21,23,25,26,31);/q;+2/p-2/t12-,13-;/m0./s1" |
| Standard InCHIKey:   | VWBBRFHSPXRJQD-QNTKWALQSA-L |
| Max Developmental Stage:   | Approved |
| Max Developmental Stage Source:   | ChEMBL |
  Structural Similarity Between NPASS Natural Products and NPD4091Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.
  Similar Natural Products High Similarity: Tc>=0.85; Intermediate Similarity: 0.7 <= Tc < 0.85; Remote Similarity: 0.5 <= Tc < 0.7
| Similarity Level | Similarity Score | Natural Product ID |
|---|---|---|
| Intermediate Similarity | 0.7011 | NPC99201 |
| Intermediate Similarity | 0.7011 | NPC269681 |
| Intermediate Similarity | 0.7011 | NPC14849 |
| Remote Similarity | 0.6196 | NPC611805 |
| Remote Similarity | 0.6022 | NPC222510 |
| Remote Similarity | 0.5773 | NPC86833 |
| Remote Similarity | 0.5354 | NPC248862 |
| Remote Similarity | 0.5152 | NPC493894 |
| TTD   | |
| DrugBank   | |
| ChEMBL   | |
| IUPHAR/BPS   | |
| PharmaGKB   | |
| KEGG Drug   | |
| PubChem CID   | 0 |
| ChEBI   | |
| CAS Number   |
| Molecular Weight   | 457.17 |
| ALogP   | -4.2885 |
| MLogP   | 2.23 |
| XLogP   | 0.648 |
| HDA   | 13 |
| HBD   | 6 |
| Rotatable Bonds   | 14 |
| TPSA   | 205.13 |
| RO5 Violation   | 2 |