Drug Information| Drug ID:   | NPD4083 |
| Drug Name:   | ecabapide |
| Molecular Formula:   | C20H25N3O4 |
| Canonical SMILES:   | COc1ccc(cc1OC)CCN=C(CNc1cccc(c1)C(=NC)O)O |
| Standard InCHI:   | "InChI=1S/C20H25N3O4/c1-21-20(25)15-5-4-6-16(12-15)23-13-19(24)22-10-9-14-7-8-17(26-2)18(11-14)27-3/h4-8,11-12,23H,9-10,13H2,1-3H3,(H,21,25)(H,22,24)" |
| Standard InCHIKey:   | JTAGHJPZEDNHHA-UHFFFAOYSA-N |
| Max Developmental Stage:   | Phase 2 |
| Max Developmental Stage Source:   | TTD |
  Structural Similarity Between NPASS Natural Products and NPD4083Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.
  Similar Natural Products High Similarity: Tc>=0.85; Intermediate Similarity: 0.7 <= Tc < 0.85; Remote Similarity: 0.5 <= Tc < 0.7
| Similarity Level | Similarity Score | Natural Product ID |
|---|---|---|
| Remote Similarity | 0.5075 | NPC301713 |
| Molecular Weight   | 371.18 |
| ALogP   | -1.08 |
| MLogP   | 2.89 |
| XLogP   | 3.102 |
| HDA   | 5 |
| HBD   | 3 |
| Rotatable Bonds   | 14 |
| TPSA   | 95.67 |
| RO5 Violation   | 0 |