Drug Information| Drug ID:   | NPD4074 |
| Drug Name:   | |
| Molecular Formula:   | C20H25N10O12P |
| Canonical SMILES:   | OC[C@H]1O[C@H]([C@@H]([C@@H]1O)OP(=O)(OC[C@H]1O[C@H]([C@@H]([C@@H]1O)O)n1cnc2c1[nH]c(=N)nc2O)O)n1cnc2c1[nH]c(=N)nc2O |
| Standard InCHI:   | "InChI=1S/C20H25N10O12P/c21-19-25-13-7(15(35)27-19)23-3-29(13)17-11(34)9(32)6(41-17)2-39-43(37,38)42-12-10(33)5(1-31)40-18(12)30-4-24-8-14(30)26-20(22)28-16(8)36/h3-6,9-12,17-18,31-34H,1-2H2,(H,37,38)(H3,21,25,27,35)(H3,22,26,28,36)/t5-,6-,9-,10-,11-,12-,17-,18-/m1/s1" |
| Standard InCHIKey:   | YYNDAHWXMRBBRC-MHARETSRSA-N |
| Max Developmental Stage:   | Clinical (unspecified phase) |
| Max Developmental Stage Source:   | TTD |
  Structural Similarity Between NPASS Natural Products and NPD4074Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.
  Similar Natural Products High Similarity: Tc>=0.85; Intermediate Similarity: 0.7 <= Tc < 0.85; Remote Similarity: 0.5 <= Tc < 0.7
| Similarity Level | Similarity Score | Natural Product ID |
|---|---|---|
| Intermediate Similarity | 0.7662 | NPC14590 |
| Intermediate Similarity | 0.7564 | NPC177169 |
| Intermediate Similarity | 0.7284 | NPC64705 |
| Intermediate Similarity | 0.7143 | NPC211820 |
| Remote Similarity | 0.6966 | NPC187707 |
| Remote Similarity | 0.6413 | NPC103057 |
| Remote Similarity | 0.64 | NPC61198 |
| Remote Similarity | 0.64 | NPC105915 |
| Remote Similarity | 0.6265 | NPC89147 |
| Remote Similarity | 0.6265 | NPC297033 |
| Remote Similarity | 0.6265 | NPC274384 |
| Remote Similarity | 0.6265 | NPC28366 |
| Remote Similarity | 0.5955 | NPC484201 |
| Remote Similarity | 0.5955 | NPC484198 |
| Remote Similarity | 0.5904 | NPC11271 |
| Remote Similarity | 0.5682 | NPC318590 |
| Remote Similarity | 0.5495 | NPC232408 |
| Remote Similarity | 0.5495 | NPC317746 |
| Remote Similarity | 0.5476 | NPC11920 |
| Remote Similarity | 0.5287 | NPC186619 |
| Remote Similarity | 0.5122 | NPC262926 |
| Molecular Weight   | 628.14 |
| ALogP   | -3.7572 |
| MLogP   | 1.13 |
| XLogP   | -4.355 |
| HDA   | 22 |
| HBD   | 11 |
| Rotatable Bonds   | 15 |
| TPSA   | 337.53 |
| RO5 Violation   | 2 |