Drug Information| Drug ID:   | NPD4055 |
| Drug Name:   | ZD-6126 |
| Molecular Formula:   | C20H24NO8P |
| Canonical SMILES:   | COc1c2c(CC[C@@H](c3c2ccc(c3)OP(=O)(O)O)N=C(O)C)cc(c1OC)OC |
| Standard InCHI:   | "InChI=1S/C20H24NO8P/c1-11(22)21-16-8-5-12-9-17(26-2)19(27-3)20(28-4)18(12)14-7-6-13(10-15(14)16)29-30(23,24)25/h6-7,9-10,16H,5,8H2,1-4H3,(H,21,22)(H2,23,24,25)/t16-/m0/s1" |
| Standard InCHIKey:   | UGBMEXLBFDAOGL-INIZCTEOSA-N |
| Max Developmental Stage:   | Phase 2 |
| Max Developmental Stage Source:   | TTD |
  Structural Similarity Between NPASS Natural Products and NPD4055Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.
  Similar Natural Products High Similarity: Tc>=0.85; Intermediate Similarity: 0.7 <= Tc < 0.85; Remote Similarity: 0.5 <= Tc < 0.7
| Similarity Level | Similarity Score | Natural Product ID |
|---|---|---|
| Remote Similarity | 0.6984 | NPC108957 |
| Remote Similarity | 0.6984 | NPC14005 |
| Remote Similarity | 0.6984 | NPC226941 |
| Remote Similarity | 0.6667 | NPC49550 |
| Remote Similarity | 0.5915 | NPC120215 |
| Remote Similarity | 0.5915 | NPC189782 |
| Remote Similarity | 0.5588 | NPC44642 |
| Remote Similarity | 0.5211 | NPC66678 |
| Remote Similarity | 0.5176 | NPC54962 |
| Remote Similarity | 0.5139 | NPC202839 |
| Remote Similarity | 0.5059 | NPC219475 |
| Molecular Weight   | 437.12 |
| ALogP   | -1.0113 |
| MLogP   | 2.56 |
| XLogP   | 1.141 |
| HDA   | 5 |
| HBD   | 3 |
| Rotatable Bonds   | 13 |
| TPSA   | 136.85 |
| RO5 Violation   | 0 |