NPASS drugs

Drug Information

Drug ID:	NPD4039
Drug Name:	Quinidine
Molecular Formula:	C20H24N2O2
Canonical SMILES:	C=C[C@H]1CN2CC[C@H]1C[C@@H]2[C@H](c1ccnc2c1cc(OC)cc2)O
Standard InCHI:	"InChI=1S/C20H24N2O2/c1-3-13-12-22-9-7-14(13)10-19(22)20(23)16-6-8-21-18-5-4-15(24-2)11-17(16)18/h3-6,8,11,13-14,19-20,23H,1,7,9-10,12H2,2H3/t13-,14-,19+,20-/m0/s1"
Standard InCHIKey:	LOUPRKONTZGTKE-LHHVKLHASA-N
Max Developmental Stage:	Phase 4
Max Developmental Stage Source:	TTD; ChEMBL; IUPHAR/BPS

Structural Similarity Between NPASS Natural Products and NPD4039

Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.

Range	Similarity Score Range
0-0.1	90103
0.1-0.2	118319
0.2-0.3	3268
0.3-0.4	13
0.4-0.5	4
0.5-0.6	7
0.6-0.7	6
0.7-0.8	8
0.8-0.85	5
0.85-0.9	0
0.9-0.95	0
0.95-1	6

Similar Natural Products

High Similarity: Tc>=0.85; Intermediate Similarity: 0.7 <= Tc < 0.85; Remote Similarity: 0.5 <= Tc < 0.7

Similarity Level	Similarity Score	Natural Product ID
High Similarity	1.0	NPC118832
High Similarity	1.0	NPC323216
High Similarity	1.0	NPC329708
High Similarity	1.0	NPC600335
High Similarity	1.0	NPC612041
High Similarity	1.0	NPC612068
Intermediate Similarity	0.8462	NPC165349
Intermediate Similarity	0.8462	NPC47059
Intermediate Similarity	0.8462	NPC324027
Intermediate Similarity	0.8462	NPC524941
Intermediate Similarity	0.8462	NPC610890
Intermediate Similarity	0.7206	NPC203754
Intermediate Similarity	0.7206	NPC150048
Intermediate Similarity	0.7206	NPC39142
Intermediate Similarity	0.7206	NPC593604
Intermediate Similarity	0.7206	NPC602282
Intermediate Similarity	0.7206	NPC603090
Intermediate Similarity	0.7101	NPC242808
Intermediate Similarity	0.7101	NPC322558
Remote Similarity	0.6901	NPC276917
Remote Similarity	0.6901	NPC227320
Remote Similarity	0.6712	NPC251430
Remote Similarity	0.6712	NPC288611
Remote Similarity	0.6133	NPC169000
Remote Similarity	0.6133	NPC125707
Remote Similarity	0.5972	NPC284856
Remote Similarity	0.5972	NPC317308
Remote Similarity	0.589	NPC567483
Remote Similarity	0.589	NPC610661
Remote Similarity	0.5769	NPC181631
Remote Similarity	0.5316	NPC264166
Remote Similarity	0.5316	NPC274291

Drug Structure

NPD4039 OpenBabel08211704332D 25 28 0 0 1 0 0 0 0 0999 V2000 -5.3560 1.3041 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.7910 4.1077 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.7324 1.1371 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.7903 2.2822 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.7904 1.3694 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.5811 -0.0002 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.3717 1.3690 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.7905 -0.4565 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.3718 2.2818 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.9529 1.3688 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.7908 2.2820 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.4852 2.1791 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.4851 1.4715 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 -3.1622 0.9124 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 -0.0003 2.7385 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.5812 0.9127 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.7907 1.3692 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.0001 0.9128 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.9530 2.2816 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 -4.7436 2.7380 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 0.0000 -0.0000 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 -3.1624 2.7383 0.0000 N 0 0 3 0 0 0 0 0 0 0 0 0 -5.1398 3.5604 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -0.0004 3.6514 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -6.0501 3.6285 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 1 3 2 0 0 0 0 2 24 1 0 0 0 0 4 5 2 0 0 0 0 4 15 1 0 0 0 0 5 18 1 0 0 0 0 6 8 2 0 0 0 0 6 16 1 0 0 0 0 7 9 1 0 0 0 0 8 21 1 0 0 0 0 9 22 1 0 0 0 0 10 14 1 0 0 0 0 10 19 1 0 0 0 0 11 15 2 0 0 0 0 11 17 1 0 0 0 0 12 13 1 0 0 0 0 12 22 1 0 0 0 0 13 3 1 1 0 0 0 13 14 1 0 0 0 0 14 7 1 1 0 0 0 15 24 1 0 0 0 0 16 17 2 0 0 0 0 17 18 1 0 0 0 0 18 21 2 0 0 0 0 19 20 1 0 0 0 0 19 22 1 6 0 0 0 20 16 1 6 0 0 0 20 23 1 0 0 0 0 23 25 1 0 0 0 0 M END $$$$

External Identifiers

TTD	DAP000515
DrugBank	DB00908
ChEMBL	CHEMBL1294
IUPHAR/BPS	2342
PharmaGKB	PA451209
KEGG Drug
PubChem CID	441074
ChEBI	28593
CAS Number	56-54-2

Drug Properties

Molecular Weight	324.18
ALogP	-0.5136
MLogP	3.22
XLogP	2.662
HDA	3
HBD	1
Rotatable Bonds	6
TPSA	45.59
RO5 Violation	0