NPASS drugs

Drug Information

Drug ID:	NPD4037
Drug Name:	Quinine Hydrochloride
Molecular Formula:	C20H24N2O2.ClH
Canonical SMILES:	C=C[C@H]1CN2CC[C@H]1C[C@H]2[C@@H](c1ccnc2c1cc(OC)cc2)O.Cl
Standard InCHI:	"InChI=1S/C20H24N2O2.ClH/c1-3-13-12-22-9-7-14(13)10-19(22)20(23)16-6-8-21-18-5-4-15(24-2)11-17(16)18;/h3-6,8,11,13-14,19-20,23H,1,7,9-10,12H2,2H3;1H/t13-,14-,19-,20+;/m0./s1"
Standard InCHIKey:	LBSFSRMTJJPTCW-DSXUQNDKSA-N
Max Developmental Stage:	Approved
Max Developmental Stage Source:	ChEMBL

Structural Similarity Between NPASS Natural Products and NPD4037

Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.

Range	Similarity Score Range
0-0.1	90424
0.1-0.2	118042
0.2-0.3	3225
0.3-0.4	12
0.4-0.5	5
0.5-0.6	7
0.6-0.7	6
0.7-0.8	8
0.8-0.85	5
0.85-0.9	0
0.9-0.95	0
0.95-1	6

Similar Natural Products

High Similarity: Tc>=0.85; Intermediate Similarity: 0.7 <= Tc < 0.85; Remote Similarity: 0.5 <= Tc < 0.7

Similarity Level	Similarity Score	Natural Product ID
High Similarity	0.9839	NPC118832
High Similarity	0.9839	NPC323216
High Similarity	0.9839	NPC329708
High Similarity	0.9839	NPC600335
High Similarity	0.9839	NPC612041
High Similarity	0.9839	NPC612068
Intermediate Similarity	0.8333	NPC165349
Intermediate Similarity	0.8333	NPC47059
Intermediate Similarity	0.8333	NPC324027
Intermediate Similarity	0.8333	NPC524941
Intermediate Similarity	0.8333	NPC610890
Intermediate Similarity	0.7101	NPC203754
Intermediate Similarity	0.7101	NPC150048
Intermediate Similarity	0.7101	NPC39142
Intermediate Similarity	0.7101	NPC593604
Intermediate Similarity	0.7101	NPC602282
Intermediate Similarity	0.7101	NPC603090
Intermediate Similarity	0.7	NPC242808
Intermediate Similarity	0.7	NPC322558
Remote Similarity	0.6806	NPC276917
Remote Similarity	0.6806	NPC227320
Remote Similarity	0.6622	NPC251430
Remote Similarity	0.6622	NPC288611
Remote Similarity	0.6053	NPC169000
Remote Similarity	0.6053	NPC125707
Remote Similarity	0.589	NPC284856
Remote Similarity	0.589	NPC317308
Remote Similarity	0.5811	NPC567483
Remote Similarity	0.5811	NPC610661
Remote Similarity	0.5696	NPC181631
Remote Similarity	0.525	NPC264166
Remote Similarity	0.525	NPC274291

Drug Structure

NPD4037 OpenBabel08211704332D 26 28 0 0 1 0 0 0 0 0999 V2000 1.1882 -3.2977 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 5.7532 -0.4941 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.8119 -3.4647 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 7.3345 -2.3196 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 7.3346 -3.2325 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.9631 -4.6020 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.1725 -3.2329 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 5.7537 -5.0584 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.1724 -2.3200 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.5913 -3.2330 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 5.7534 -2.3198 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.0590 -2.4228 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.0591 -3.1304 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 3.3820 -3.6895 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 6.5439 -1.8633 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.9630 -3.6892 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 5.7535 -3.2327 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 6.5441 -3.6890 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.5912 -2.3202 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 1.8006 -1.8639 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 6.5442 -4.6018 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 3.3818 -1.8636 0.0000 N 0 0 3 0 0 0 0 0 0 0 0 0 1.4044 -1.0415 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 6.5438 -0.9504 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -0.9781 -1.0205 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0 0.4941 -0.9733 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 1 3 2 0 0 0 0 2 24 1 0 0 0 0 4 5 2 0 0 0 0 4 15 1 0 0 0 0 5 18 1 0 0 0 0 6 8 2 0 0 0 0 6 16 1 0 0 0 0 7 9 1 0 0 0 0 8 21 1 0 0 0 0 9 22 1 0 0 0 0 10 14 1 0 0 0 0 10 19 1 0 0 0 0 11 15 2 0 0 0 0 11 17 1 0 0 0 0 12 13 1 0 0 0 0 12 22 1 0 0 0 0 13 3 1 1 0 0 0 13 14 1 0 0 0 0 14 7 1 1 0 0 0 15 24 1 0 0 0 0 16 17 2 0 0 0 0 17 18 1 0 0 0 0 18 21 2 0 0 0 0 19 20 1 0 0 0 0 19 22 1 1 0 0 0 20 16 1 1 0 0 0 20 23 1 0 0 0 0 23 26 1 0 0 0 0 M END $$$$

External Identifiers

TTD
DrugBank
ChEMBL
IUPHAR/BPS
PharmaGKB
KEGG Drug
PubChem CID	0
ChEBI
CAS Number

Drug Properties

Molecular Weight	324.18
ALogP	-0.5136
MLogP	3.22
XLogP	2.662
HDA	3
HBD	1
Rotatable Bonds	6
TPSA	45.59
RO5 Violation	0