Drug Information| Drug ID:   | NPD3998 |
| Drug Name:   | Leucovorin |
| Molecular Formula:   | C20H23N7O7 |
| Canonical SMILES:   | O=CN1C(CNc2ccc(cc2)C(=O)N[C@H](C(=O)O)CCC(=O)O)CNc2c1c(O)nc(=N)[nH]2 |
| Standard InCHI:   | "InChI=1S/C20H23N7O7/c21-20-25-16-15(18(32)26-20)27(9-28)12(8-23-16)7-22-11-3-1-10(2-4-11)17(31)24-13(19(33)34)5-6-14(29)30/h1-4,9,12-13,22H,5-8H2,(H,24,31)(H,29,30)(H,33,34)(H4,21,23,25,26,32)/t12?,13-/m0/s1" |
| Standard InCHIKey:   | VVIAGPKUTFNRDU-ABLWVSNPSA-N |
| Max Developmental Stage:   | Phase 4 |
| Max Developmental Stage Source:   | ChEMBL; IUPHAR/BPS |
  Structural Similarity Between NPASS Natural Products and NPD3998Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.
  Similar Natural Products High Similarity: Tc>=0.85; Intermediate Similarity: 0.7 <= Tc < 0.85; Remote Similarity: 0.5 <= Tc < 0.7
| Similarity Level | Similarity Score | Natural Product ID |
|---|---|---|
| High Similarity | 1.0 | NPC131450 |
| High Similarity | 1.0 | NPC150469 |
| High Similarity | 1.0 | NPC182057 |
| High Similarity | 1.0 | NPC86831 |
| High Similarity | 1.0 | NPC147298 |
| Intermediate Similarity | 0.7701 | NPC193812 |
| Remote Similarity | 0.6739 | NPC86833 |
| Remote Similarity | 0.6522 | NPC611381 |
| Remote Similarity | 0.6522 | NPC611432 |
| Remote Similarity | 0.6105 | NPC248862 |
| Remote Similarity | 0.6022 | NPC99201 |
| Remote Similarity | 0.6022 | NPC269681 |
| Remote Similarity | 0.6022 | NPC14849 |
| Remote Similarity | 0.5957 | NPC328611 |
| Remote Similarity | 0.5556 | NPC262143 |
| Molecular Weight   | 473.17 |
| ALogP   | -3.7521 |
| MLogP   | 2.12 |
| XLogP   | -0.04 |
| HDA   | 14 |
| HBD   | 8 |
| Rotatable Bonds   | 14 |
| TPSA   | 216.54 |
| RO5 Violation   | 3 |