Drug Information| Drug ID:   | NPD3990 |
| Drug Name:   | Folitixorin |
| Molecular Formula:   | C20H23N7O6 |
| Canonical SMILES:   | OC(=O)CC[C@@H](C(=O)O)NC(=O)c1ccc(cc1)N1CC2N(C1)c1c(O)nc(=N)[nH]c1NC2 |
| Standard InCHI:   | "InChI=1S/C20H23N7O6/c21-20-24-16-15(18(31)25-20)27-9-26(8-12(27)7-22-16)11-3-1-10(2-4-11)17(30)23-13(19(32)33)5-6-14(28)29/h1-4,12-13H,5-9H2,(H,23,30)(H,28,29)(H,32,33)(H4,21,22,24,25,31)/t12?,13-/m0/s1" |
| Standard InCHIKey:   | QYNUQALWYRSVHF-ABLWVSNPSA-N |
| Max Developmental Stage:   | Phase 3 |
| Max Developmental Stage Source:   | ChEMBL |
  Structural Similarity Between NPASS Natural Products and NPD3990Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.
  Similar Natural Products High Similarity: Tc>=0.85; Intermediate Similarity: 0.7 <= Tc < 0.85; Remote Similarity: 0.5 <= Tc < 0.7
| Similarity Level | Similarity Score | Natural Product ID |
|---|---|---|
| Remote Similarity | 0.6854 | NPC99201 |
| Remote Similarity | 0.6854 | NPC269681 |
| Remote Similarity | 0.6854 | NPC14849 |
| Remote Similarity | 0.5876 | NPC519391 |
| Remote Similarity | 0.5714 | NPC248862 |
| Remote Similarity | 0.51 | NPC328611 |
| Remote Similarity | 0.5049 | NPC131450 |
| Remote Similarity | 0.5049 | NPC150469 |
| Remote Similarity | 0.5049 | NPC182057 |
| Remote Similarity | 0.5049 | NPC86831 |
| Remote Similarity | 0.5049 | NPC147298 |
| TTD   | DIB003601; DIB004511 |
| DrugBank   | |
| ChEMBL   | |
| IUPHAR/BPS   | |
| PharmaGKB   | |
| KEGG Drug   | |
| PubChem CID   | 108194 |
| ChEBI   | |
| CAS Number   |
| Molecular Weight   | 457.17 |
| ALogP   | -2.5961 |
| MLogP   | 2.23 |
| XLogP   | 1.295 |
| HDA   | 13 |
| HBD   | 7 |
| Rotatable Bonds   | 11 |
| TPSA   | 190.68 |
| RO5 Violation   | 2 |