Drug Information| Drug ID:   | NPD3987 |
| Drug Name:   | Azlocillin Sodium |
| Molecular Formula:   | C20H23N5O6S.Na |
| Canonical SMILES:   | OC(=O)[C@@H]1N2C(=O)[C@H]([C@H]2SC1(C)C)N=C([C@@H](c1ccccc1)N=C(N1CCN=C1O)O)[O-].[Na+] |
| Standard InCHI:   | "InChI=1S/C20H23N5O6S.Na/c1-20(2)13(17(28)29)25-15(27)12(16(25)32-20)22-14(26)11(10-6-4-3-5-7-10)23-19(31)24-9-8-21-18(24)30;/h3-7,11-13,16H,8-9H2,1-2H3,(H,21,30)(H,22,26)(H,23,31)(H,28,29);/q;+1/p-1/t11-,12-,13+,16-;/m1./s1" |
| Standard InCHIKey:   | UVOCNBWUHNCKJM-XFAPPKAWSA-M |
| Max Developmental Stage:   | Approved |
| Max Developmental Stage Source:   | ChEMBL |
  Structural Similarity Between NPASS Natural Products and NPD3987Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.
  Similar Natural Products High Similarity: Tc>=0.85; Intermediate Similarity: 0.7 <= Tc < 0.85; Remote Similarity: 0.5 <= Tc < 0.7
| Similarity Level | Similarity Score | Natural Product ID |
|---|---|---|
| Remote Similarity | 0.5541 | NPC485035 |
| Remote Similarity | 0.5541 | NPC469134 |
| Remote Similarity | 0.5132 | NPC330588 |
| Remote Similarity | 0.5065 | NPC90478 |
| TTD   | |
| DrugBank   | |
| ChEMBL   | |
| IUPHAR/BPS   | |
| PharmaGKB   | |
| KEGG Drug   | |
| PubChem CID   | 0 |
| ChEBI   | |
| CAS Number   |
| Molecular Weight   | 460.13 |
| ALogP   | -0.6271 |
| MLogP   | 2.34 |
| XLogP   | 2.809 |
| HDA   | 11 |
| HBD   | 3 |
| Rotatable Bonds   | 12 |
| TPSA   | 186.75 |
| RO5 Violation   | 1 |