NPASS drugs

Drug Information

Drug ID:	NPD3961
Drug Name:	romergoline
Molecular Formula:	C20H22N4O2
Canonical SMILES:	OC1=NC(=O)CN(C1)C[C@H]1CN(C)[C@H]2C(=C1)c1cccc3c1c(C2)c[nH]3
Standard InCHI:	"InChI=1S/C20H22N4O2/c1-23-8-12(9-24-10-18(25)22-19(26)11-24)5-15-14-3-2-4-16-20(14)13(7-21-16)6-17(15)23/h2-5,7,12,17,21H,6,8-11H2,1H3,(H,22,25,26)/t12-,17-/m1/s1"
Standard InCHIKey:	RJCXNCSJGRUWRW-SJKOYZFVSA-N
Max Developmental Stage:	Phase 2
Max Developmental Stage Source:	TTD

Structural Similarity Between NPASS Natural Products and NPD3961

Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.

Range	Similarity Score Range
0-0.1	164430
0.1-0.2	45146
0.2-0.3	2036
0.3-0.4	38
0.4-0.5	55
0.5-0.6	30
0.6-0.7	5
0.7-0.8	0
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similar Natural Products

High Similarity: Tc>=0.85; Intermediate Similarity: 0.7 <= Tc < 0.85; Remote Similarity: 0.5 <= Tc < 0.7

Similarity Level	Similarity Score	Natural Product ID
Remote Similarity	0.6761	NPC570281
Remote Similarity	0.6429	NPC589958
Remote Similarity	0.6429	NPC606264
Remote Similarity	0.6316	NPC313654
Remote Similarity	0.6216	NPC194411
Remote Similarity	0.5949	NPC558145
Remote Similarity	0.5949	NPC572522
Remote Similarity	0.5946	NPC275305
Remote Similarity	0.5946	NPC37423
Remote Similarity	0.5946	NPC491234
Remote Similarity	0.5946	NPC577263
Remote Similarity	0.5732	NPC68354
Remote Similarity	0.5732	NPC285055
Remote Similarity	0.5714	NPC508875
Remote Similarity	0.5714	NPC509923
Remote Similarity	0.5663	NPC325904
Remote Similarity	0.5663	NPC520778
Remote Similarity	0.5663	NPC593969
Remote Similarity	0.5663	NPC604662
Remote Similarity	0.5595	NPC269208
Remote Similarity	0.5529	NPC526211
Remote Similarity	0.5529	NPC611966
Remote Similarity	0.5465	NPC504538
Remote Similarity	0.5444	NPC46468
Remote Similarity	0.5256	NPC57047
Remote Similarity	0.5256	NPC598241
Remote Similarity	0.5217	NPC527833
Remote Similarity	0.5217	NPC545520
Remote Similarity	0.5217	NPC566122
Remote Similarity	0.5195	NPC90408
Remote Similarity	0.5195	NPC230660
Remote Similarity	0.5132	NPC567556
Remote Similarity	0.5132	NPC600946
Remote Similarity	0.5128	NPC113927
Remote Similarity	0.5128	NPC19757

Drug Structure

NPD3961 OpenBabel08211704332D 28 32 0 0 1 0 0 0 0 0999 V2000 4.0943 1.3625 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 6.4531 -2.7691 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 5.6670 -2.3153 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 7.2390 -2.3153 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.0949 -1.4080 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 5.6666 0.4076 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 7.2388 0.4077 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.3085 -0.0466 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.4817 -1.4321 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.8275 -1.4324 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.6543 0.0004 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.3087 -0.9543 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 6.4529 -0.0461 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 5.6670 -1.4078 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.8809 -0.9540 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 7.2391 -1.4074 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.8807 -0.0463 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 0.0002 -0.9551 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.8270 0.4777 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 6.4529 -0.9540 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 8.0250 -0.9536 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 -0.0000 -0.0000 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 4.0945 0.4074 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 1.6545 -0.9547 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 -0.8268 -1.4328 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 0.8268 1.4328 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 8.9402 -1.1987 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.6540 -0.9555 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 1 23 1 0 0 0 0 2 3 2 0 0 0 0 2 4 1 0 0 0 0 3 14 1 0 0 0 0 4 16 2 0 0 0 0 5 12 1 0 0 0 0 5 15 2 0 0 0 0 6 13 1 0 0 0 0 7 13 2 0 0 0 0 7 21 1 0 0 0 0 8 12 1 0 0 0 0 8 23 1 0 0 0 0 9 24 1 0 0 0 0 10 18 1 0 0 0 0 10 24 1 0 0 0 0 11 19 1 0 0 0 0 11 24 1 0 0 0 0 12 9 1 1 0 0 0 13 20 1 0 0 0 0 14 15 1 0 0 0 0 14 20 2 0 0 0 0 15 17 1 0 0 0 0 16 20 1 0 0 0 0 16 21 1 0 0 0 0 17 6 1 6 0 0 0 17 23 1 0 0 0 0 18 22 2 0 0 0 0 18 25 1 0 0 0 0 19 22 1 0 0 0 0 19 26 2 0 0 0 0 21 27 1 0 0 0 0 25 28 1 0 0 0 0 M END $$$$

External Identifiers

TTD	DIB013719
DrugBank
ChEMBL
IUPHAR/BPS
PharmaGKB
KEGG Drug
PubChem CID	0
ChEBI
CAS Number

Drug Properties

Molecular Weight	350.17
ALogP	-1.5453
MLogP	3
XLogP	1.054
HDA	6
HBD	2
Rotatable Bonds	4
TPSA	71.93
RO5 Violation	0