NPASS drugs

Drug Information

Drug ID:	NPD3923
Drug Name:	Papaverine Hydrochloride
Molecular Formula:	C20H21NO4.ClH
Canonical SMILES:	COc1ccc(cc1OC)Cc1nccc2c1cc(OC)c(c2)OC.Cl
Standard InCHI:	"InChI=1S/C20H21NO4.ClH/c1-22-17-6-5-13(10-18(17)23-2)9-16-15-12-20(25-4)19(24-3)11-14(15)7-8-21-16;/h5-8,10-12H,9H2,1-4H3;1H"
Standard InCHIKey:	UOTMYNBWXDUBNX-UHFFFAOYSA-N
Max Developmental Stage:	Approved
Max Developmental Stage Source:	ChEMBL

Structural Similarity Between NPASS Natural Products and NPD3923

Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.

Range	Similarity Score Range
0-0.1	142300
0.1-0.2	65662
0.2-0.3	3578
0.3-0.4	149
0.4-0.5	25
0.5-0.6	11
0.6-0.7	5
0.7-0.8	2
0.8-0.85	2
0.85-0.9	0
0.9-0.95	0
0.95-1	4

Similar Natural Products

High Similarity: Tc>=0.85; Intermediate Similarity: 0.7 <= Tc < 0.85; Remote Similarity: 0.5 <= Tc < 0.7

Similarity Level	Similarity Score	Natural Product ID
High Similarity	1.0	NPC133140
High Similarity	1.0	NPC612029
High Similarity	0.9767	NPC195268
High Similarity	0.9767	NPC611808
Intermediate Similarity	0.8261	NPC563670
Intermediate Similarity	0.8261	NPC607909
Intermediate Similarity	0.74	NPC53161
Intermediate Similarity	0.7255	NPC527823
Remote Similarity	0.6981	NPC285875
Remote Similarity	0.6731	NPC165693
Remote Similarity	0.6481	NPC557619
Remote Similarity	0.6207	NPC582614
Remote Similarity	0.6111	NPC146976
Remote Similarity	0.5932	NPC600003
Remote Similarity	0.5893	NPC516511
Remote Similarity	0.5862	NPC611090
Remote Similarity	0.5789	NPC538176
Remote Similarity	0.5455	NPC236668
Remote Similarity	0.5417	NPC93476
Remote Similarity	0.5263	NPC245351
Remote Similarity	0.5167	NPC519299
Remote Similarity	0.5161	NPC519523
Remote Similarity	0.5082	NPC481459
Remote Similarity	0.5082	NPC481460

Drug Structure

NPD3923 OpenBabel08211704332D 26 27 0 0 0 0 0 0 0 0999 V2000 7.4282 -3.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 6.5622 -0.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.3660 -6.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.9641 -6.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.9641 -3.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.8301 -3.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.5000 -3.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.5000 -2.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.0981 -1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.8301 -1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.3660 -4.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.0981 -3.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.9641 -2.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.3660 -3.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.2321 -3.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.2321 -2.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 5.6962 -3.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 5.6962 -2.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.2321 -5.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.0981 -4.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.3660 -1.5000 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 6.5622 -3.5000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 6.5622 -1.5000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 2.2321 -6.0000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 3.9641 -5.0000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -2.7382 -4.0504 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0 1 22 1 0 0 0 0 2 23 1 0 0 0 0 3 24 1 0 0 0 0 4 25 1 0 0 0 0 5 6 2 0 0 0 0 5 13 1 0 0 0 0 6 17 1 0 0 0 0 7 8 2 0 0 0 0 7 14 1 0 0 0 0 8 21 1 0 0 0 0 9 13 1 0 0 0 0 9 16 1 0 0 0 0 10 13 2 0 0 0 0 10 18 1 0 0 0 0 11 14 2 0 0 0 0 11 19 1 0 0 0 0 12 15 2 0 0 0 0 12 20 1 0 0 0 0 14 15 1 0 0 0 0 15 16 1 0 0 0 0 16 21 2 0 0 0 0 17 18 2 0 0 0 0 17 22 1 0 0 0 0 18 23 1 0 0 0 0 19 20 2 0 0 0 0 19 24 1 0 0 0 0 20 25 1 0 0 0 0 M END $$$$

External Identifiers

TTD
DrugBank
ChEMBL
IUPHAR/BPS
PharmaGKB
KEGG Drug
PubChem CID	0
ChEBI
CAS Number

Drug Properties

Molecular Weight	339.15
ALogP	0.114
MLogP	3.11
XLogP	3.363
HDA	1
HBD	0
Rotatable Bonds	10
TPSA	49.81
RO5 Violation	0