NPASS drugs

Drug Information

Drug ID:	NPD389
Drug Name:	Glufosfamide
Molecular Formula:	C10H21Cl2N2O7P
Canonical SMILES:	ClCCNP(=O)(O[C@@H]1O[C@H](CO)[C@H]([C@@H]([C@H]1O)O)O)NCCCl
Standard InCHI:	"InChI=1S/C10H21Cl2N2O7P/c11-1-3-13-22(19,14-4-2-12)21-10-9(18)8(17)7(16)6(5-15)20-10/h6-10,15-18H,1-5H2,(H2,13,14,19)/t6-,7-,8+,9-,10+/m1/s1"
Standard InCHIKey:	PSVUJBVBCOISSP-SPFKKGSWSA-N
Max Developmental Stage:	Phase 3
Max Developmental Stage Source:	ChEMBL

Structural Similarity Between NPASS Natural Products and NPD389

Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.

Range	Similarity Score Range
0-0.1	121113
0.1-0.2	72631
0.2-0.3	14823
0.3-0.4	2970
0.4-0.5	176
0.5-0.6	3
0.6-0.7	6
0.7-0.8	0
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similar Natural Products

High Similarity: Tc>=0.85; Intermediate Similarity: 0.7 <= Tc < 0.85; Remote Similarity: 0.5 <= Tc < 0.7

Similarity Level	Similarity Score	Natural Product ID
Remote Similarity	0.625	NPC181455
Remote Similarity	0.625	NPC325403
Remote Similarity	0.625	NPC30374
Remote Similarity	0.625	NPC509450
Remote Similarity	0.625	NPC605930
Remote Similarity	0.625	NPC586365
Remote Similarity	0.525	NPC329551
Remote Similarity	0.525	NPC167283
Remote Similarity	0.5106	NPC578853

Drug Structure

NPD389 OpenBabel08201723122D 28 28 0 0 1 0 0 0 0 0999 V2000 -0.8660 2.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.5000 0.8660 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.8660 1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.5000 0.8660 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.0000 -1.7321 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.0000 -1.7321 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 2.5000 -2.5981 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 1.5000 -2.5981 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 1.0000 -1.7321 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 1.5000 -0.8660 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 0.0000 3.0000 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0 -3.0000 1.7321 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0 0.0000 1.0000 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 -1.0000 0.0000 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 4.5000 -2.5981 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 3.0000 -3.4641 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 1.0000 -3.4641 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -0.0000 -1.7321 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -0.0000 -1.0000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 2.5000 -0.8660 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 1.0000 -0.0000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 0.0000 -0.0000 0.0000 P 0 0 0 0 0 0 0 0 0 0 0 0 0.8660 1.5000 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.5000 -0.8660 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 5.5000 -2.5981 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 2.5000 -4.3301 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 0.0000 -3.4641 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.5000 -0.8660 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 1 3 1 0 0 0 0 1 11 1 0 0 0 0 2 4 1 0 0 0 0 2 12 1 0 0 0 0 3 13 1 0 0 0 0 4 14 1 0 0 0 0 5 15 1 0 0 0 0 6 5 1 6 0 0 0 6 7 1 0 0 0 0 6 20 1 0 0 0 0 7 8 1 0 0 0 0 7 16 1 1 0 0 0 8 9 1 0 0 0 0 8 17 1 6 0 0 0 9 10 1 0 0 0 0 9 18 1 1 0 0 0 10 20 1 0 0 0 0 10 21 1 6 0 0 0 13 22 1 0 0 0 0 13 23 1 0 0 0 0 14 22 1 0 0 0 0 14 24 1 0 0 0 0 15 25 1 0 0 0 0 16 26 1 0 0 0 0 17 27 1 0 0 0 0 18 28 1 0 0 0 0 19 22 2 0 0 0 0 21 22 1 0 0 0 0 M END $$$$

External Identifiers

TTD	DCL000816
DrugBank
ChEMBL
IUPHAR/BPS
PharmaGKB
KEGG Drug
PubChem CID	123628
ChEBI
CAS Number

Drug Properties

Molecular Weight	382.05
ALogP	-1.7042
MLogP	1.24
XLogP	-1.179
HDA	9
HBD	6
Rotatable Bonds	15
TPSA	150.32
RO5 Violation	1