Drug Information| Drug ID:   | NPD3877 |
| Drug Name:   | |
| Molecular Formula:   | C20H20N6O7S4 |
| Canonical SMILES:   | CO/N=C(/c1csc(=N)[nH]1)C(=N[C@@H]1C(=O)N2[C@@H]1SCC(=C2C(=O)O)CSc1nc(c(s1)CC(=O)[O-])C)[O-] |
| Standard InCHI:   | "InChI=1S/C20H20N6O7S4/c1-7-10(3-11(27)28)37-20(22-7)36-5-8-4-34-17-13(16(30)26(17)14(8)18(31)32)24-15(29)12(25-33-2)9-6-35-19(21)23-9/h6,13,17H,3-5H2,1-2H3,(H2,21,23)(H,24,29)(H,27,28)(H,31,32)/p-2/b25-12-/t13-,17-/m1/s1" |
| Standard InCHIKey:   | XDZKBRJLTGRPSS-BGZQYGJUSA-L |
| Max Developmental Stage:   | Approved |
| Max Developmental Stage Source:   | TTD |
  Structural Similarity Between NPASS Natural Products and NPD3877Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.
| TTD   | DNAP001461 |
| DrugBank   | |
| ChEMBL   | |
| IUPHAR/BPS   | |
| PharmaGKB   | |
| KEGG Drug   | |
| PubChem CID   | 9852176 |
| ChEBI   | |
| CAS Number   |
| Molecular Weight   | 582.01 |
| ALogP   | -0.5068 |
| MLogP   | 1.79 |
| XLogP   | 1.004 |
| HDA   | 11 |
| HBD   | 3 |
| Rotatable Bonds   | 15 |
| TPSA   | 307.66 |
| RO5 Violation   | 1 |