Drug Information| Drug ID:   | NPD3825 |
| Drug Name:   | Idalopirdine |
| Molecular Formula:   | C20H19F5N2O |
| Canonical SMILES:   | Fc1ccc2c(c1)[nH]cc2CCNCc1cccc(c1)OCC(C(F)F)(F)F |
| Standard InCHI:   | "InChI=1S/C20H19F5N2O/c21-15-4-5-17-14(11-27-18(17)9-15)6-7-26-10-13-2-1-3-16(8-13)28-12-20(24,25)19(22)23/h1-5,8-9,11,19,26-27H,6-7,10,12H2" |
| Standard InCHIKey:   | YBAWYTYNMZWMMJ-UHFFFAOYSA-N |
| Max Developmental Stage:   | Phase 3 |
| Max Developmental Stage Source:   | ChEMBL |
  Structural Similarity Between NPASS Natural Products and NPD3825Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.
  Similar Natural Products High Similarity: Tc>=0.85; Intermediate Similarity: 0.7 <= Tc < 0.85; Remote Similarity: 0.5 <= Tc < 0.7
| Similarity Level | Similarity Score | Natural Product ID |
|---|---|---|
| Remote Similarity | 0.5286 | NPC141926 |
| TTD   | DNCL001976 |
| DrugBank   | |
| ChEMBL   | |
| IUPHAR/BPS   | |
| PharmaGKB   | |
| KEGG Drug   | |
| PubChem CID   | 21071390 |
| ChEBI   | |
| CAS Number   |
| Molecular Weight   | 398.14 |
| ALogP   | 0.8706 |
| MLogP   | 2.78 |
| XLogP   | 5.48 |
| HDA   | 2 |
| HBD   | 2 |
| Rotatable Bonds   | 14 |
| TPSA   | 37.05 |
| RO5 Violation   | 1 |