NPASS drugs

Drug Information

Drug ID:	NPD378
Drug Name:	dutogliptin
Molecular Formula:	C10H20BN3O3
Canonical SMILES:	OB([C@@H]1CCCN1C(=O)CN[C@H]1CNCC1)O
Standard InCHI:	InChI=1S/C10H20BN3O3/c15-10(7-13-8-3-4-12-6-8)14-5-1-2-9(14)11(16)17/h8-9,12-13,16-17H,1-7H2/t8-,9+/m1/s1
Standard InCHIKey:	DVJAMEIQRSHVKC-BDAKNGLRSA-N
Max Developmental Stage:	Phase 3
Max Developmental Stage Source:	TTD

Structural Similarity Between NPASS Natural Products and NPD378

Similarity level is defined by Tanimoto coefficient (Tc) between two molecules. Tc lies between [0, 1] where '1' indicates the highest similarity. What is Tanimoto coefficient
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.

Range	Similarity Score Range
0-0.1	6653
0.1-0.2	20073
0.2-0.3	3137
0.3-0.4	739
0.4-0.5	256
0.5-0.6	28
0.6-0.7	3
0.7-0.8	1
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similar Natural Products

High Similarity Level: Tc>=0.85; Intermediate Similarity Level: 0.7 <= Tc < 0.85; Remote Similarity Level: 0.65 <= Tc < 0.7

Similarity Level	Similarity Score	Natural Product ID
Intermediate Similarity	0.7042	NPC320221
Remote Similarity	0.625	NPC322274
Remote Similarity	0.6056	NPC287693
Remote Similarity	0.6053	NPC327272
Remote Similarity	0.5789	NPC29326
Remote Similarity	0.5625	NPC204607

Drug Structure

NPD378 OpenBabel08201723122D 21 22 0 0 1 0 0 0 0 0999 V2000 1.2024 1.0827 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.6092 0.1691 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.3962 0.0531 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.9840 0.8621 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.2079 0.9781 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.4451 1.3621 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.7226 0.1810 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.4451 0.3621 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 0.8660 -0.5000 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 -0.9135 -0.4067 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.9706 -1.4945 0.0000 B 0 0 0 0 0 0 0 0 0 0 0 0 -4.3962 1.6711 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 -2.6361 -0.2257 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 0.0000 -0.0000 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 -1.0181 -1.4013 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 0.1615 -2.0823 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 1.8841 -1.9013 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.7052 2.6222 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.7406 -1.2202 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 0.2661 -3.0768 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 1.9886 -2.8958 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 1 2 1 0 0 0 0 1 5 1 0 0 0 0 2 9 1 0 0 0 0 3 4 1 0 0 0 0 3 8 1 0 0 0 0 4 12 1 0 0 0 0 5 14 1 0 0 0 0 6 8 1 0 0 0 0 6 12 1 0 0 0 0 7 10 1 0 0 0 0 7 13 1 0 0 0 0 8 13 1 6 0 0 0 9 11 1 1 0 0 0 9 14 1 0 0 0 0 10 14 1 0 0 0 0 10 15 2 0 0 0 0 11 16 1 0 0 0 0 11 17 1 0 0 0 0 12 18 1 0 0 0 0 13 19 1 0 0 0 0 16 20 1 0 0 0 0 17 21 1 0 0 0 0 M END $$$$

External Identifiers

TTD	DIB013859
DrugBank
ChEMBL
IUPHAR/BPS
PharmaGKB
KEGG Drug
PubChem CID
ChEBI
CAS Number

Drug Properties

Molecular Weight	241.16
ALogP	-3.2333
MLogP	1.79
XLogP	-1.559
HDA	6
HBD	4
Rotatable Bonds	7
TPSA	84.83
RO5 Violation	0