NPASS drugs

Drug Information

Drug ID:	NPD3678
Drug Name:	Gepirone
Molecular Formula:	C19H29N5O2
Canonical SMILES:	O=C1CC(C)(C)CC(=O)N1CCCCN1CCN(CC1)c1ncccn1
Standard InCHI:	InChI=1S/C19H29N5O2/c1-19(2)14-16(25)24(17(26)15-19)9-4-3-8-22-10-12-23(13-11-22)18-20-6-5-7-21-18/h5-7H,3-4,8-15H2,1-2H3
Standard InCHIKey:	QOIGKGMMAGJZNZ-UHFFFAOYSA-N
Max Developmental Stage:	Phase 2
Max Developmental Stage Source:	ChEMBL

Structural Similarity Between NPASS Natural Products and NPD3678

Similarity level is defined by Tanimoto coefficient (Tc) between two molecules. Tc lies between [0, 1] where '1' indicates the highest similarity. What is Tanimoto coefficient
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.

Range	Similarity Score Range
0-0.1	240
0.1-0.2	21560
0.2-0.3	5552
0.3-0.4	2293
0.4-0.5	1142
0.5-0.6	99
0.6-0.7	4
0.7-0.8	0
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similar Natural Products

High Similarity Level: Tc>=0.85; Intermediate Similarity Level: 0.7 <= Tc < 0.85; Remote Similarity Level: 0.65 <= Tc < 0.7

Similarity Level	Similarity Score	Natural Product ID
Remote Similarity	0.6721	NPC326364
Remote Similarity	0.6484	NPC476128
Remote Similarity	0.625	NPC27699
Remote Similarity	0.6103	NPC222061
Remote Similarity	0.5985	NPC163105
Remote Similarity	0.5808	NPC472833
Remote Similarity	0.5799	NPC472832
Remote Similarity	0.5799	NPC18308
Remote Similarity	0.5741	NPC197068
Remote Similarity	0.5723	NPC226184
Remote Similarity	0.5723	NPC76544
Remote Similarity	0.5723	NPC167285
Remote Similarity	0.5704	NPC329046
Remote Similarity	0.5652	NPC75844
Remote Similarity	0.5625	NPC256849

Drug Structure

NPD3678 OpenBabel08211703112D 26 28 0 0 0 0 0 0 0 0999 V2000 -7.6353 -2.7071 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.0043 -2.3827 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.1962 1.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.0622 1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.8660 -1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.0000 -2.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.8660 -0.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.3301 1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.9282 1.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.5981 1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.4641 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.7321 1.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.5981 -0.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.0622 -1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.7942 -1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.0622 -0.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.7942 -0.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.8660 -0.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.9282 -2.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.8660 -1.5000 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 0.0000 -0.0000 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 -3.4641 1.0000 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 -1.7321 0.0000 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 -6.9282 0.0000 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 -5.1962 -0.0000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -8.6603 0.0000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 1 19 1 0 0 0 0 2 19 1 0 0 0 0 3 4 1 0 0 0 0 3 8 1 0 0 0 0 4 9 1 0 0 0 0 5 6 2 0 0 0 0 5 7 1 0 0 0 0 6 20 1 0 0 0 0 7 21 2 0 0 0 0 8 22 1 0 0 0 0 9 24 1 0 0 0 0 10 12 1 0 0 0 0 10 22 1 0 0 0 0 11 13 1 0 0 0 0 11 22 1 0 0 0 0 12 23 1 0 0 0 0 13 23 1 0 0 0 0 14 16 1 0 0 0 0 14 19 1 0 0 0 0 15 17 1 0 0 0 0 15 19 1 0 0 0 0 16 24 1 0 0 0 0 16 25 2 0 0 0 0 17 24 1 0 0 0 0 17 26 2 0 0 0 0 18 20 2 0 0 0 0 18 21 1 0 0 0 0 18 23 1 0 0 0 0 M END $$$$

External Identifiers

TTD	DCL000413; DIB000806; DCL000813; DNC000687; DCL000414
DrugBank
ChEMBL
IUPHAR/BPS
PharmaGKB
KEGG Drug
PubChem CID	55191; 55190
ChEBI
CAS Number

Drug Properties

Molecular Weight	359.23
ALogP	-0.2545
MLogP	2.78
XLogP	1.356
HDA	7
HBD	0
Rotatable Bonds	8
TPSA	69.64
RO5 Violation	0