Drug Information| Drug ID:   | NPD366 |
| Drug Name:   | |
| Molecular Formula:   | C10H18N4O5 |
| Canonical SMILES:   | N=C(N=C(CCC(=O)O)O)NCCC[C@@H](C(=O)O)N |
| Standard InCHI:   | "InChI=1S/C10H18N4O5/c11-6(9(18)19)2-1-5-13-10(12)14-7(15)3-4-8(16)17/h6H,1-5,11H2,(H,16,17)(H,18,19)(H3,12,13,14,15)/t6-/m0/s1" |
| Standard InCHIKey:   | RWJGOCSNMZSTIJ-LURJTMIESA-N |
| Max Developmental Stage:   | Approved |
| Max Developmental Stage Source:   | TTD |
  Structural Similarity Between NPASS Natural Products and NPD366Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.
  Similar Natural Products High Similarity: Tc>=0.85; Intermediate Similarity: 0.7 <= Tc < 0.85; Remote Similarity: 0.5 <= Tc < 0.7
| Similarity Level | Similarity Score | Natural Product ID |
|---|---|---|
| Remote Similarity | 0.5319 | NPC118429 |
| Remote Similarity | 0.5319 | NPC120635 |
| Remote Similarity | 0.5306 | NPC478850 |
| Remote Similarity | 0.5306 | NPC609636 |
| Molecular Weight   | 274.13 |
| ALogP   | -2.5674 |
| MLogP   | 1.57 |
| XLogP   | -3.501 |
| HDA   | 9 |
| HBD   | 6 |
| Rotatable Bonds   | 14 |
| TPSA   | 169.09 |
| RO5 Violation   | 1 |