Drug Information| Drug ID:   | NPD3645 |
| Drug Name:   | Org-20781 |
| Molecular Formula:   | C19H27NO3 |
| Canonical SMILES:   | CN[C@H]1[C@H](O)C[C@@H]2[C@]1(C)CC[C@H]1[C@H]2CCc2c1cc(O)c(c2)O |
| Standard InCHI:   | "InChI=1S/C19H27NO3/c1-19-6-5-11-12(14(19)9-17(23)18(19)20-2)4-3-10-7-15(21)16(22)8-13(10)11/h7-8,11-12,14,17-18,20-23H,3-6,9H2,1-2H3/t11-,12+,14-,17+,18-,19-/m0/s1" |
| Standard InCHIKey:   | YVBSZXJRJYYVQR-AFKMTKAPSA-N |
| Max Developmental Stage:   | Discontinued |
| Max Developmental Stage Source:   | TTD |
  Structural Similarity Between NPASS Natural Products and NPD3645Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.
| Molecular Weight   | 317.2 |
| ALogP   | -1.0107 |
| MLogP   | 3.11 |
| XLogP   | 3.623 |
| HDA   | 2 |
| HBD   | 4 |
| Rotatable Bonds   | 6 |
| TPSA   | 72.72 |
| RO5 Violation   | 0 |