NPASS drugs

Drug Information

Drug ID:	NPD3637
Drug Name:	(-)-Pentazocine; Pentazocine
Molecular Formula:	C19H27NO
Canonical SMILES:	CC(=CCN1CC[C@@]2([C@H]([C@H]1Cc1c2cc(cc1)O)C)C)C
Standard InCHI:	"InChI=1S/C19H27NO/c1-13(2)7-9-20-10-8-19(4)14(3)18(20)11-15-5-6-16(21)12-17(15)19/h5-7,12,14,18,21H,8-11H2,1-4H3/t14-,18+,19+/m0/s1"
Standard InCHIKey:	VOKSWYLNZZRQPF-GDIGMMSISA-N
Max Developmental Stage:	Approved
Max Developmental Stage Source:	TTD; ChEMBL; IUPHAR/BPS

Structural Similarity Between NPASS Natural Products and NPD3637

Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.

Range	Similarity Score Range
0-0.1	121747
0.1-0.2	86584
0.2-0.3	3354
0.3-0.4	39
0.4-0.5	2
0.5-0.6	2
0.6-0.7	5
0.7-0.8	0
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	7

Similar Natural Products

High Similarity: Tc>=0.85; Intermediate Similarity: 0.7 <= Tc < 0.85; Remote Similarity: 0.5 <= Tc < 0.7

Similarity Level	Similarity Score	Natural Product ID
High Similarity	1.0	NPC99681
High Similarity	1.0	NPC66177
High Similarity	1.0	NPC268763
High Similarity	1.0	NPC310909
High Similarity	1.0	NPC8305
High Similarity	1.0	NPC609479
High Similarity	1.0	NPC609598
Remote Similarity	0.6949	NPC259665
Remote Similarity	0.6949	NPC126859
Remote Similarity	0.6949	NPC89769
Remote Similarity	0.6949	NPC603520
Remote Similarity	0.6949	NPC607296
Remote Similarity	0.5781	NPC124802
Remote Similarity	0.5781	NPC609824

Drug Structure

NPD3637 OpenBabel08211703112D 22 24 0 0 1 0 0 0 0 0999 V2000 -3.0391 -0.0002 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.2793 -1.3161 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.7600 1.3165 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.2797 1.3165 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.0400 -0.8772 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.7999 -0.4383 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.5196 -0.0001 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.7600 1.3164 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.7598 -0.4387 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.0000 0.8778 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.5198 -0.8775 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.0397 0.8779 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.2793 -0.4388 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.7600 0.4390 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 2.2800 -0.4386 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.7998 0.4392 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.2798 0.4389 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.7598 -0.4387 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 1.5198 0.8777 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 0.0000 -0.0000 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 4.5596 0.8782 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 5.3197 0.4395 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 1 13 1 0 0 0 0 2 13 1 0 0 0 0 3 14 1 0 0 0 0 5 6 2 0 0 0 0 5 15 1 0 0 0 0 6 16 1 0 0 0 0 7 9 1 0 0 0 0 7 13 2 0 0 0 0 8 10 1 0 0 0 0 8 19 1 0 0 0 0 9 20 1 0 0 0 0 10 20 1 0 0 0 0 11 15 1 0 0 0 0 12 16 2 0 0 0 0 12 17 1 0 0 0 0 14 18 1 0 0 0 0 14 19 1 6 0 0 0 15 17 2 0 0 0 0 16 21 1 0 0 0 0 17 19 1 0 0 0 0 18 11 1 1 0 0 0 18 20 1 0 0 0 0 19 4 1 6 0 0 0 21 22 1 0 0 0 0 M END $$$$

External Identifiers

TTD	DAP000356
DrugBank	DB00652
ChEMBL	CHEMBL560
IUPHAR/BPS	1606
PharmaGKB	PA164744326
KEGG Drug	D00498
PubChem CID	441278
ChEBI	7982
CAS Number	359-83-1

Drug Properties

Molecular Weight	285.21
ALogP	1.8055
MLogP	3.33
XLogP	4.091
HDA	1
HBD	1
Rotatable Bonds	7
TPSA	23.47
RO5 Violation	0