NPASS drugs

Drug Information

Drug ID:	NPD3636
Drug Name:	Pentazocine Hydrochloride
Molecular Formula:	C19H27NO.ClH
Canonical SMILES:	CC(=CCN1CC[C@@]2([C@H]([C@H]1Cc1c2cc(cc1)O)C)C)C.Cl
Standard InCHI:	"InChI=1S/C19H27NO.ClH/c1-13(2)7-9-20-10-8-19(4)14(3)18(20)11-15-5-6-16(21)12-17(15)19;/h5-7,12,14,18,21H,8-11H2,1-4H3;1H/t14-,18+,19+;/m0./s1"
Standard InCHIKey:	OQGYMIIFOSJQSF-DTOXXUQYSA-N
Max Developmental Stage:	Approved
Max Developmental Stage Source:	ChEMBL

Structural Similarity Between NPASS Natural Products and NPD3636

Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.

Range	Similarity Score Range
0-0.1	122090
0.1-0.2	86088
0.2-0.3	3523
0.3-0.4	23
0.4-0.5	2
0.5-0.6	2
0.6-0.7	5
0.7-0.8	0
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	7

Similar Natural Products

High Similarity: Tc>=0.85; Intermediate Similarity: 0.7 <= Tc < 0.85; Remote Similarity: 0.5 <= Tc < 0.7

Similarity Level	Similarity Score	Natural Product ID
High Similarity	0.9796	NPC99681
High Similarity	0.9796	NPC66177
High Similarity	0.9796	NPC268763
High Similarity	0.9796	NPC310909
High Similarity	0.9796	NPC8305
High Similarity	0.9796	NPC609479
High Similarity	0.9796	NPC609598
Remote Similarity	0.6833	NPC259665
Remote Similarity	0.6833	NPC126859
Remote Similarity	0.6833	NPC89769
Remote Similarity	0.6833	NPC603520
Remote Similarity	0.6833	NPC607296
Remote Similarity	0.5692	NPC124802
Remote Similarity	0.5692	NPC609824

Drug Structure

NPD3636 OpenBabel08211703112D 23 24 0 0 1 0 0 0 0 0999 V2000 0.4570 -2.9722 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.7731 -3.7319 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.6500 -0.4571 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 5.6898 -0.4570 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 6.4501 -2.6508 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 7.2100 -2.2119 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.7730 -2.2123 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.1701 -0.4572 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.6503 -2.2123 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.4100 -0.8958 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.9298 -2.6510 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 6.4497 -0.8957 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.3344 -2.9721 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.1700 -1.3346 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 5.6900 -2.2122 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 7.2098 -1.3343 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 5.6898 -1.3346 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.1698 -2.2122 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 4.9298 -0.8959 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 3.4100 -1.7736 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 7.9697 -0.8954 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -2.6854 -1.4087 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0 8.7297 -1.3340 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 1 13 1 0 0 0 0 2 13 1 0 0 0 0 3 14 1 0 0 0 0 5 6 2 0 0 0 0 5 15 1 0 0 0 0 6 16 1 0 0 0 0 7 9 1 0 0 0 0 7 13 2 0 0 0 0 8 10 1 0 0 0 0 8 19 1 0 0 0 0 9 20 1 0 0 0 0 10 20 1 0 0 0 0 11 15 1 0 0 0 0 12 16 2 0 0 0 0 12 17 1 0 0 0 0 14 18 1 0 0 0 0 14 19 1 6 0 0 0 15 17 2 0 0 0 0 16 21 1 0 0 0 0 17 19 1 0 0 0 0 18 11 1 1 0 0 0 18 20 1 0 0 0 0 19 4 1 6 0 0 0 21 23 1 0 0 0 0 M END $$$$

External Identifiers

TTD
DrugBank
ChEMBL
IUPHAR/BPS
PharmaGKB
KEGG Drug
PubChem CID	0
ChEBI
CAS Number

Drug Properties

Molecular Weight	285.21
ALogP	1.8055
MLogP	3.33
XLogP	4.091
HDA	1
HBD	1
Rotatable Bonds	7
TPSA	23.47
RO5 Violation	0