NPASS drugs

Drug Information

Drug ID:	NPD3534
Drug Name:
Molecular Formula:	C19H23NO4
Canonical SMILES:	COC1=C[C@@H]2[C@@H]3Cc4c([C@@]2(CC1=O)CCN3C)c(O)c(cc4)OC
Standard InCHI:	"InChI=1S/C19H23NO4/c1-20-7-6-19-10-14(21)16(24-3)9-12(19)13(20)8-11-4-5-15(23-2)18(22)17(11)19/h4-5,9,12-13,22H,6-8,10H2,1-3H3/t12-,13+,19-/m1/s1"
Standard InCHIKey:	INYYVPJSBIVGPH-QHRIQVFBSA-N
Max Developmental Stage:	Phase 3
Max Developmental Stage Source:	TTD

Structural Similarity Between NPASS Natural Products and NPD3534

Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.

Range	Similarity Score Range
0-0.1	91779
0.1-0.2	113923
0.2-0.3	5840
0.3-0.4	134
0.4-0.5	37
0.5-0.6	10
0.6-0.7	8
0.7-0.8	6
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	3

Similar Natural Products

High Similarity: Tc>=0.85; Intermediate Similarity: 0.7 <= Tc < 0.85; Remote Similarity: 0.5 <= Tc < 0.7

Similarity Level	Similarity Score	Natural Product ID
High Similarity	1.0	NPC298339
High Similarity	1.0	NPC541030
High Similarity	1.0	NPC611727
Intermediate Similarity	0.7794	NPC244191
Intermediate Similarity	0.7794	NPC578054
Intermediate Similarity	0.7647	NPC535798
Intermediate Similarity	0.7353	NPC493690
Intermediate Similarity	0.7353	NPC538843
Intermediate Similarity	0.7246	NPC275625
Remote Similarity	0.6901	NPC327583
Remote Similarity	0.6901	NPC538021
Remote Similarity	0.6667	NPC522753
Remote Similarity	0.6438	NPC127588
Remote Similarity	0.6438	NPC254959
Remote Similarity	0.6438	NPC125088
Remote Similarity	0.6438	NPC582385
Remote Similarity	0.6438	NPC597665
Remote Similarity	0.5733	NPC3375
Remote Similarity	0.5733	NPC255607
Remote Similarity	0.5733	NPC602499
Remote Similarity	0.5325	NPC508177
Remote Similarity	0.5325	NPC595363
Remote Similarity	0.5195	NPC76884
Remote Similarity	0.5195	NPC326152
Remote Similarity	0.519	NPC556211
Remote Similarity	0.5063	NPC92875
Remote Similarity	0.5063	NPC6412

Drug Structure

NPD3534 OpenBabel08211703112D 25 28 0 0 1 0 0 0 0 0999 V2000 -2.1607 1.5041 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.3335 -1.3889 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.8004 -3.2425 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.7283 1.3898 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.5307 0.9268 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.4634 0.8018 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.4636 1.7282 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.1239 0.4629 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.8014 -1.3899 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.8025 -0.4627 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.9261 0.9264 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.8019 -0.4636 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 -0.8022 0.4628 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 0.8030 -1.3890 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.5309 0.0004 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.0011 -1.8526 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.9263 -0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.7287 -0.4630 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.0000 -0.0000 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 -1.2658 1.2648 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 1.6055 -1.8517 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 1.7289 -1.3893 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 3.3333 -0.4626 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 0.0016 -2.7789 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 2.5313 -1.8523 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 1 20 1 0 0 0 0 2 23 1 0 0 0 0 3 24 1 0 0 0 0 4 5 2 0 0 0 0 4 11 1 0 0 0 0 5 15 1 0 0 0 0 6 7 1 0 0 0 0 7 20 1 0 0 0 0 8 11 1 0 0 0 0 9 12 1 0 0 0 0 9 16 2 0 0 0 0 10 14 1 0 0 0 0 10 19 1 0 0 0 0 11 17 2 0 0 0 0 12 13 1 0 0 0 0 12 19 1 1 0 0 0 13 8 1 1 0 0 0 13 20 1 0 0 0 0 14 16 1 0 0 0 0 14 21 2 0 0 0 0 15 18 2 0 0 0 0 15 23 1 0 0 0 0 16 24 1 0 0 0 0 17 18 1 0 0 0 0 17 19 1 0 0 0 0 18 22 1 0 0 0 0 19 6 1 1 0 0 0 22 25 1 0 0 0 0 M END $$$$

External Identifiers

TTD	DIB011271
DrugBank
ChEMBL
IUPHAR/BPS
PharmaGKB
KEGG Drug
PubChem CID	0
ChEBI
CAS Number

Drug Properties

Molecular Weight	329.16
ALogP	-0.7813
MLogP	3
XLogP	1.294
HDA	3
HBD	1
Rotatable Bonds	6
TPSA	59
RO5 Violation	0