Drug Information| Drug ID:   | NPD3522 |
| Drug Name:   | Tetrahydrofolic acid |
| Molecular Formula:   | C19H23N7O6 |
| Canonical SMILES:   | OC(=O)CC[C@@H](C(=O)O)NC(=O)c1ccc(cc1)NCC1CNc2c(N1)c(O)nc(=N)[nH]2 |
| Standard InCHI:   | "InChI=1S/C19H23N7O6/c20-19-25-15-14(17(30)26-19)23-11(8-22-15)7-21-10-3-1-9(2-4-10)16(29)24-12(18(31)32)5-6-13(27)28/h1-4,11-12,21,23H,5-8H2,(H,24,29)(H,27,28)(H,31,32)(H4,20,22,25,26,30)/t11?,12-/m0/s1" |
| Standard InCHIKey:   | MSTNYGQPCMXVAQ-KIYNQFGBSA-N |
| Max Developmental Stage:   | Approved |
| Max Developmental Stage Source:   | TTD; DrugBank |
  Structural Similarity Between NPASS Natural Products and NPD3522Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.
  Similar Natural Products High Similarity: Tc>=0.85; Intermediate Similarity: 0.7 <= Tc < 0.85; Remote Similarity: 0.5 <= Tc < 0.7
| Similarity Level | Similarity Score | Natural Product ID |
|---|---|---|
| High Similarity | 1.0 | NPC328611 |
| Intermediate Similarity | 0.7241 | NPC262143 |
| Remote Similarity | 0.6782 | NPC222510 |
| Remote Similarity | 0.6364 | NPC607357 |
| Remote Similarity | 0.6292 | NPC99201 |
| Remote Similarity | 0.6292 | NPC269681 |
| Remote Similarity | 0.6292 | NPC14849 |
| Remote Similarity | 0.6022 | NPC248862 |
| Remote Similarity | 0.5957 | NPC131450 |
| Remote Similarity | 0.5957 | NPC150469 |
| Remote Similarity | 0.5957 | NPC182057 |
| Remote Similarity | 0.5957 | NPC86831 |
| Remote Similarity | 0.5957 | NPC147298 |
| Remote Similarity | 0.5934 | NPC598350 |
| TTD   | DAP001308 |
| DrugBank   | DB00116 |
| ChEMBL   | CHEMBL2021342 |
| IUPHAR/BPS   | |
| PharmaGKB   | PA164745110 |
| KEGG Drug   | |
| PubChem CID   | 91443 |
| ChEBI   | 20506 |
| CAS Number   | 135-16-0 |
| Molecular Weight   | 445.17 |
| ALogP   | -3.4688 |
| MLogP   | 2.12 |
| XLogP   | 0.875 |
| HDA   | 13 |
| HBD   | 9 |
| Rotatable Bonds   | 13 |
| TPSA   | 208.26 |
| RO5 Violation   | 2 |