Drug Information| Drug ID:   | NPD3491 |
| Drug Name:   | |
| Molecular Formula:   | C19H22N8O6S2 |
| Canonical SMILES:   | OCC[n+]1c(N)ccn1CC1=C(C(=O)O)N2[C@H](SC1)[C@@H](C2=O)N=C(/C(=N/OC)/c1csc(=N)[nH]1)[O-] |
| Standard InCHI:   | "InChI=1S/C19H22N8O6S2/c1-33-24-12(10-8-35-19(21)22-10)15(29)23-13-16(30)27-14(18(31)32)9(7-34-17(13)27)6-25-3-2-11(20)26(25)4-5-28/h2-3,8,13,17,20,28H,4-7H2,1H3,(H4,21,22,23,29,31,32)/b24-12+/t13-,17-/m1/s1" |
| Standard InCHIKey:   | BHXLLRXDAYEMPP-AKZFGVKSSA-N |
| Max Developmental Stage:   | Approved |
| Max Developmental Stage Source:   | TTD |
  Structural Similarity Between NPASS Natural Products and NPD3491Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.
  Similar Natural Products High Similarity: Tc>=0.85; Intermediate Similarity: 0.7 <= Tc < 0.85; Remote Similarity: 0.5 <= Tc < 0.7
| Similarity Level | Similarity Score | Natural Product ID |
|---|---|---|
| Remote Similarity | 0.6277 | NPC483027 |
| TTD   | DNAP001395 |
| DrugBank   | |
| ChEMBL   | |
| IUPHAR/BPS   | |
| PharmaGKB   | |
| KEGG Drug   | |
| PubChem CID   | 9589475 |
| ChEBI   | |
| CAS Number   |
| Molecular Weight   | 522.11 |
| ALogP   | -3.8624 |
| MLogP   | 1.79 |
| XLogP   | -2.93 |
| HDA   | 11 |
| HBD   | 5 |
| Rotatable Bonds   | 14 |
| TPSA   | 256.16 |
| RO5 Violation   | 1 |