Drug Information| Drug ID: | NPD349 |
| Drug Name: | Dexpramipexole Dihydrochloride |
| Molecular Formula: | C10H17N3S.2ClH.H2O |
| Canonical SMILES: | CCCN[C@@H]1CCc2c(C1)sc(=N)[nH]2.O.Cl.Cl |
| Standard InCHI: | InChI=1S/C10H17N3S.2ClH.H2O/c1-2-5-12-7-3-4-8-9(6-7)14-10(11)13-8;;;/h7,12H,2-6H2,1H3,(H2,11,13);2*1H;1H2/t7-;;;/m1.../s1 |
| Standard InCHIKey: | APVQOOKHDZVJEX-LSBIWMFESA-N |
| Max Developmental Stage: | Phase 2 |
| Max Developmental Stage Source: | ChEMBL |
Structural Similarity Between NPASS Natural Products and NPD349Similarity level is defined by Tanimoto coefficient (Tc) between two molecules. Tc lies between [0, 1] where '1' indicates the highest similarity. What is Tanimoto coefficient 
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.
Similar Natural Products High Similarity Level: Tc>=0.85; Intermediate Similarity Level: 0.7 <= Tc < 0.85; Remote Similarity Level: 0.65 <= Tc < 0.7
| Similarity Level | Similarity Score | Natural Product ID |
|---|---|---|
| Remote Similarity | 0.5814 | NPC57599 |