NPASS drugs

Drug Information

Drug ID:	NPD331
Drug Name:	Edetate Disodium
Molecular Formula:	C10H16N2O8.2Na
Canonical SMILES:	[O-]C(=O)CN(CC(=O)[O-])CCN(CC(=O)O)CC(=O)O.[Na+].[Na+]
Standard InCHI:	InChI=1S/C10H16N2O8.2Na/c13-7(14)3-11(4-8(15)16)1-2-12(5-9(17)18)6-10(19)20;;/h1-6H2,(H,13,14)(H,15,16)(H,17,18)(H,19,20);;/q;2*+1/p-2
Standard InCHIKey:	ZGTMUACCHSMWAC-UHFFFAOYSA-L
Max Developmental Stage:	Approved
Max Developmental Stage Source:	ChEMBL

Structural Similarity Between NPASS Natural Products and NPD331

Similarity level is defined by Tanimoto coefficient (Tc) between two molecules. Tc lies between [0, 1] where '1' indicates the highest similarity. What is Tanimoto coefficient
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.

Range	Similarity Score Range
0-0.1	1637
0.1-0.2	23822
0.2-0.3	4363
0.3-0.4	744
0.4-0.5	272
0.5-0.6	45
0.6-0.7	5
0.7-0.8	2
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similar Natural Products

High Similarity Level: Tc>=0.85; Intermediate Similarity Level: 0.7 <= Tc < 0.85; Remote Similarity Level: 0.65 <= Tc < 0.7

Similarity Level	Similarity Score	Natural Product ID
Intermediate Similarity	0.7368	NPC59650
Intermediate Similarity	0.7317	NPC216443
Remote Similarity	0.6458	NPC195448
Remote Similarity	0.6429	NPC134570
Remote Similarity	0.6222	NPC274550
Remote Similarity	0.6136	NPC69179
Remote Similarity	0.6042	NPC198301
Remote Similarity	0.5952	NPC260324
Remote Similarity	0.5909	NPC1591
Remote Similarity	0.5862	NPC177191
Remote Similarity	0.5854	NPC325909
Remote Similarity	0.575	NPC126681
Remote Similarity	0.5714	NPC40511

Drug Structure

NPD331 OpenBabel08201723122D 24 21 0 0 0 0 0 0 0 0999 V2000 3.9641 -3.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.8301 -3.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.0981 -2.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.2321 -3.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 5.6962 -4.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 6.5622 -3.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.9641 -1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.3660 -3.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.8301 -5.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 7.4282 -3.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.0981 -3.0000 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 5.6962 -3.5000 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 3.9641 -0.5000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 4.8301 -2.0000 0.0000 O 0 5 0 0 0 0 0 0 0 0 0 0 1.3660 -2.0000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 0.5000 -3.5000 0.0000 O 0 5 0 0 0 0 0 0 0 0 0 0 3.9641 -4.5000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 4.8301 -6.0000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 7.4282 -4.5000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 8.2942 -3.0000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 0.5935 -1.9252 0.0000 Na 0 3 0 0 0 15 0 0 0 0 0 0 10.1603 -0.5000 0.0000 Na 0 3 0 0 0 15 0 0 0 0 0 0 3.9641 -6.5000 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 9.1603 -3.5000 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 1 2 1 0 0 0 0 1 11 1 0 0 0 0 2 12 1 0 0 0 0 3 7 1 0 0 0 0 3 11 1 0 0 0 0 4 8 1 0 0 0 0 4 11 1 0 0 0 0 5 9 1 0 0 0 0 5 12 1 0 0 0 0 6 10 1 0 0 0 0 6 12 1 0 0 0 0 7 13 2 0 0 0 0 7 14 1 0 0 0 0 8 15 2 0 0 0 0 8 16 1 0 0 0 0 9 17 2 0 0 0 0 9 18 1 0 0 0 0 10 19 2 0 0 0 0 10 20 1 0 0 0 0 18 23 1 0 0 0 0 20 24 1 0 0 0 0 M CHG 4 14 -1 16 -1 21 1 22 1 M END $$$$

External Identifiers

TTD
DrugBank
ChEMBL
IUPHAR/BPS
PharmaGKB
KEGG Drug
PubChem CID
ChEBI
CAS Number

Drug Properties

Molecular Weight	290.08
ALogP	-3.0724
MLogP	1.46
XLogP	-3.518
HDA	10
HBD	2
Rotatable Bonds	15
TPSA	161.34
RO5 Violation	1