Drug Information| Drug ID:   | NPD3200 |
| Drug Name:   | |
| Molecular Formula:   | C18H35N3O12 |
| Canonical SMILES:   | NC[C@H]1O[C@H](O[C@H]2[C@H](N)C[C@@H]([C@H]([C@@H]2O)O[C@H]2O[C@H](CO)[C@H]([C@@H]([C@H]2O)O)O)N)[C@@H]([C@H]([C@@H]1O)O)O |
| Standard InCHI:   | "InChI=1S/C18H35N3O12/c19-2-6-8(23)10(25)12(27)17(30-6)32-15-4(20)1-5(21)16(14(15)29)33-18-13(28)11(26)9(24)7(3-22)31-18/h4-18,22-29H,1-3,19-21H2/t4-,5+,6-,7-,8-,9-,10+,11+,12-,13-,14-,15+,16-,17-,18-/m1/s1" |
| Standard InCHIKey:   | NZCOZAMBHLSNDW-GUKOCFKPSA-N |
| Max Developmental Stage:   | Clinical (unspecified phase) |
| Max Developmental Stage Source:   | TTD |
  Structural Similarity Between NPASS Natural Products and NPD3200Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.
  Similar Natural Products High Similarity: Tc>=0.85; Intermediate Similarity: 0.7 <= Tc < 0.85; Remote Similarity: 0.5 <= Tc < 0.7
| Similarity Level | Similarity Score | Natural Product ID |
|---|---|---|
| Intermediate Similarity | 0.7917 | NPC43850 |
| Intermediate Similarity | 0.7917 | NPC485811 |
| Intermediate Similarity | 0.7917 | NPC505645 |
| Intermediate Similarity | 0.7917 | NPC599806 |
| Intermediate Similarity | 0.717 | NPC477060 |
| Intermediate Similarity | 0.717 | NPC506438 |
| Intermediate Similarity | 0.717 | NPC608466 |
| Remote Similarity | 0.6604 | NPC552436 |
| Remote Similarity | 0.625 | NPC605029 |
| Remote Similarity | 0.5745 | NPC505651 |
| Remote Similarity | 0.5439 | NPC495214 |
| Remote Similarity | 0.5439 | NPC552868 |
| Remote Similarity | 0.5439 | NPC611754 |
| Remote Similarity | 0.52 | NPC83248 |
| Remote Similarity | 0.5167 | NPC523807 |
| Remote Similarity | 0.5094 | NPC70574 |
| Remote Similarity | 0.5094 | NPC560817 |
| Molecular Weight   | 485.22 |
| ALogP   | -7.2041 |
| MLogP   | 1.79 |
| XLogP   | -5.419 |
| HDA   | 15 |
| HBD   | 11 |
| Rotatable Bonds   | 17 |
| TPSA   | 276.82 |
| RO5 Violation   | 2 |