Drug Information| Drug ID:   | NPD317 |
| Drug Name:   | |
| Molecular Formula:   | C10H15NO2 |
| Canonical SMILES:   | CNC(C(c1ccc(cc1)O)O)C |
| Standard InCHI:   | "InChI=1S/C10H15NO2/c1-7(11-2)10(13)8-3-5-9(12)6-4-8/h3-7,10-13H,1-2H3" |
| Standard InCHIKey:   | OXFGTKPPFSCSMA-UHFFFAOYSA-N |
| Max Developmental Stage:   | Phase 2 |
| Max Developmental Stage Source:   | TTD |
  Structural Similarity Between NPASS Natural Products and NPD317Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.
  Similar Natural Products High Similarity: Tc>=0.85; Intermediate Similarity: 0.7 <= Tc < 0.85; Remote Similarity: 0.5 <= Tc < 0.7
| Similarity Level | Similarity Score | Natural Product ID |
|---|---|---|
| Remote Similarity | 0.6452 | NPC147000 |
| Remote Similarity | 0.6452 | NPC226778 |
| Remote Similarity | 0.6452 | NPC304078 |
| Remote Similarity | 0.6452 | NPC304761 |
| Remote Similarity | 0.6452 | NPC286400 |
| Remote Similarity | 0.6452 | NPC599866 |
| Remote Similarity | 0.6452 | NPC606653 |
| Remote Similarity | 0.6452 | NPC607075 |
| Remote Similarity | 0.6452 | NPC611822 |
| Remote Similarity | 0.625 | NPC150254 |
| Remote Similarity | 0.5862 | NPC319088 |
| Remote Similarity | 0.5588 | NPC124830 |
| Remote Similarity | 0.5588 | NPC213 |
| Remote Similarity | 0.5588 | NPC10286 |
| Remote Similarity | 0.5588 | NPC604424 |
| Remote Similarity | 0.5588 | NPC609563 |
| Remote Similarity | 0.5312 | NPC290566 |
| Remote Similarity | 0.5312 | NPC145638 |
| Remote Similarity | 0.5312 | NPC282434 |
| Remote Similarity | 0.5312 | NPC313650 |
| Remote Similarity | 0.5312 | NPC602477 |
| Remote Similarity | 0.5312 | NPC609790 |
| Remote Similarity | 0.5312 | NPC611792 |
| Molecular Weight   | 181.11 |
| ALogP   | -1.2882 |
| MLogP   | 2.23 |
| XLogP   | 0.924 |
| HDA   | 2 |
| HBD   | 3 |
| Rotatable Bonds   | 7 |
| TPSA   | 52.49 |
| RO5 Violation   | 0 |