Drug Information| Drug ID:   | NPD3136 |
| Drug Name:   | CMS-024 |
| Molecular Formula:   | C18H27N3O6 |
| Canonical SMILES:   | OC[C@@H](C(=N[C@H](C(=O)O)CC(C)C)O)N=C([C@H](Cc1ccc(cc1)O)N)O |
| Standard InCHI:   | "InChI=1S/C18H27N3O6/c1-10(2)7-14(18(26)27)20-17(25)15(9-22)21-16(24)13(19)8-11-3-5-12(23)6-4-11/h3-6,10,13-15,22-23H,7-9,19H2,1-2H3,(H,20,25)(H,21,24)(H,26,27)/t13-,14-,15-/m0/s1" |
| Standard InCHIKey:   | MQGGXGKQSVEQHR-KKUMJFAQSA-N |
| Max Developmental Stage:   | Phase 2 |
| Max Developmental Stage Source:   | TTD |
  Structural Similarity Between NPASS Natural Products and NPD3136Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.
| Molecular Weight   | 381.19 |
| ALogP   | -1.6423 |
| MLogP   | 2.45 |
| XLogP   | -1.518 |
| HDA   | 8 |
| HBD   | 6 |
| Rotatable Bonds   | 18 |
| TPSA   | 168.96 |
| RO5 Violation   | 1 |