NPASS drugs

Drug Information

Drug ID:	NPD3131
Drug Name:	Methylatropine Nitrate
Molecular Formula:	C18H26NO3.NO3
Canonical SMILES:	[O-]N(=O)=O.OCC(c1ccccc1)C(=O)O[C@@H]1C[C@@H]2CC[C@H](C1)[N+]2(C)C
Standard InCHI:	InChI=1S/C18H26NO3.NO3/c1-19(2)14-8-9-15(19)11-16(10-14)22-18(21)17(12-20)13-6-4-3-5-7-13;2-1(3)4/h3-7,14-17,20H,8-12H2,1-2H3;/q+1;-1/t14-,15+,16+,17?;
Standard InCHIKey:	NEDVJZNVOSNSHF-KUMOIWDRSA-N
Max Developmental Stage:	Approved
Max Developmental Stage Source:	ChEMBL

Structural Similarity Between NPASS Natural Products and NPD3131

Similarity level is defined by Tanimoto coefficient (Tc) between two molecules. Tc lies between [0, 1] where '1' indicates the highest similarity. What is Tanimoto coefficient
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.

Range	Similarity Score Range
0-0.1	76
0.1-0.2	405
0.2-0.3	1044
0.3-0.4	3560
0.4-0.5	13834
0.5-0.6	10689
0.6-0.7	1186
0.7-0.8	83
0.8-0.85	3
0.85-0.9	2
0.9-0.95	3
0.95-1	5

Similar Natural Products

High Similarity Level: Tc>=0.85; Intermediate Similarity Level: 0.7 <= Tc < 0.85; Remote Similarity Level: 0.65 <= Tc < 0.7

Show entries

Search:

Similarity Level	Similarity Score	Natural Product ID
High Similarity	1.0	NPC213126
High Similarity	1.0	NPC317474
High Similarity	1.0	NPC291027
High Similarity	1.0	NPC84281
High Similarity	1.0	NPC169485
High Similarity	0.9421	NPC69496
High Similarity	0.9194	NPC245836
High Similarity	0.9194	NPC233910
High Similarity	0.878	NPC474847
High Similarity	0.871	NPC65310

Showing 1 to 10 of 200 entries

Previous1 2 3 4 5…20Next

Drug Structure

NPD3131 OpenBabel08211702562D 27 28 0 0 1 0 0 0 0 0999 V2000 2.6603 -1.9186 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.0725 -2.7276 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.9742 -4.8001 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.8056 -4.3201 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.1428 -4.3201 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.8056 -3.3600 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.1428 -3.3600 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.7147 -0.5050 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.1269 -1.3140 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.0036 -0.5310 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.2409 -1.5808 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.1428 -1.4400 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.9742 -2.8800 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.6658 -0.8140 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 0.7147 -2.1230 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 0.3695 -0.8722 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 2.9742 -1.9200 0.0000 C 0 0 3 0 0 0 0 0 0 0 0 0 3.8056 -1.4400 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.6658 -1.8140 0.0000 N 0 3 0 0 0 0 0 0 0 0 0 0 1.3114 -1.9200 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 4.6370 -1.9200 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 3.8056 -0.4800 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 6.4284 -0.9600 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 7.2598 -0.4800 0.0000 O 0 5 0 0 0 0 0 0 0 0 0 0 5.5970 -0.4800 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 6.4284 -1.9200 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 0.4800 -1.4400 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 1 19 1 0 0 0 0 2 19 1 0 0 0 0 3 4 2 0 0 0 0 3 5 1 0 0 0 0 4 6 1 0 0 0 0 5 7 2 0 0 0 0 6 13 2 0 0 0 0 7 13 1 0 0 0 0 8 9 1 0 0 0 0 10 14 1 0 0 0 0 10 16 1 0 0 0 0 11 15 1 0 0 0 0 11 16 1 0 0 0 0 12 17 1 0 0 0 0 12 20 1 0 0 0 0 13 17 1 0 0 0 0 14 8 1 6 0 0 0 14 19 1 0 0 0 0 15 9 1 6 0 0 0 15 19 1 0 0 0 0 16 22 1 6 0 0 0 17 18 1 0 0 0 0 18 21 2 0 0 0 0 18 22 1 0 0 0 0 20 27 1 0 0 0 0 23 24 1 0 0 0 0 23 25 2 0 0 0 0 23 26 2 0 0 0 0 M CHG 2 19 1 24 -1 M END $$$$

External Identifiers

TTD
DrugBank
ChEMBL
IUPHAR/BPS
PharmaGKB
KEGG Drug
PubChem CID
ChEBI
CAS Number

Drug Properties

Molecular Weight	304.19
ALogP	-3.227
MLogP	3
XLogP	3.347
HDA	3
HBD	1
Rotatable Bonds	8
TPSA	46.53
RO5 Violation	0