Drug Information| Drug ID:   | NPD3121 |
| Drug Name:   | Mericitabine |
| Molecular Formula:   | C18H26FN3O6 |
| Canonical SMILES:   | O=C(C(C)C)O[C@@H]1[C@@H](COC(=O)C(C)C)O[C@H]([C@]1(C)F)n1ccc(=N)nc1O |
| Standard InCHI:   | "InChI=1S/C18H26FN3O6/c1-9(2)14(23)26-8-11-13(28-15(24)10(3)4)18(5,19)16(27-11)22-7-6-12(20)21-17(22)25/h6-7,9-11,13,16H,8H2,1-5H3,(H2,20,21,25)/t11-,13-,16-,18-/m1/s1" |
| Standard InCHIKey:   | MLESJYFEMSJZLZ-MAAOGQSESA-N |
| Max Developmental Stage:   | Phase 2 |
| Max Developmental Stage Source:   | ChEMBL |
  Structural Similarity Between NPASS Natural Products and NPD3121Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.
  Similar Natural Products High Similarity: Tc>=0.85; Intermediate Similarity: 0.7 <= Tc < 0.85; Remote Similarity: 0.5 <= Tc < 0.7
| Similarity Level | Similarity Score | Natural Product ID |
|---|---|---|
| NPC |
| Molecular Weight   | 399.18 |
| ALogP   | 0.9637 |
| MLogP   | 2.34 |
| XLogP   | 2.677 |
| HDA   | 9 |
| HBD   | 2 |
| Rotatable Bonds   | 15 |
| TPSA   | 121.51 |
| RO5 Violation   | 0 |