Drug Information| Drug ID: | NPD312 |
| Drug Name: | |
| Molecular Formula: | C10H15NO |
| Canonical SMILES: | C#CCOC1CN2CCC1CC2 |
| Standard InCHI: | InChI=1S/C10H15NO/c1-2-7-12-10-8-11-5-3-9(10)4-6-11/h1,9-10H,3-8H2 |
| Standard InCHIKey: | XVFJONKUSLSKSW-UHFFFAOYSA-N |
| Max Developmental Stage: | Clinical (unspecified phase) |
| Max Developmental Stage Source: | TTD |
Structural Similarity Between NPASS Natural Products and NPD312Similarity level is defined by Tanimoto coefficient (Tc) between two molecules. Tc lies between [0, 1] where '1' indicates the highest similarity. What is Tanimoto coefficient 
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.
Similar Natural Products High Similarity Level: Tc>=0.85; Intermediate Similarity Level: 0.7 <= Tc < 0.85; Remote Similarity Level: 0.65 <= Tc < 0.7
| Similarity Level | Similarity Score | Natural Product ID |
|---|---|---|
| Remote Similarity | 0.5844 | NPC90839 |
| Remote Similarity | 0.5833 | NPC255050 |
| Remote Similarity | 0.5833 | NPC127553 |
| Remote Similarity | 0.5696 | NPC149908 |
| Remote Similarity | 0.5696 | NPC288415 |
| Remote Similarity | 0.5696 | NPC31313 |
| Remote Similarity | 0.5696 | NPC45906 |
| Remote Similarity | 0.5672 | NPC112398 |
| Remote Similarity | 0.5625 | NPC93630 |