Drug Information| Drug ID: | NPD311 |
| Drug Name: | Pseudoephedrine Sulfate |
| Molecular Formula: | C10H15NO.H2O4S |
| Canonical SMILES: | OS(=O)(=O)O.CN[C@H]([C@H](c1ccccc1)O)C |
| Standard InCHI: | InChI=1S/C10H15NO.H2O4S/c1-8(11-2)10(12)9-6-4-3-5-7-9;1-5(2,3)4/h3-8,10-12H,1-2H3;(H2,1,2,3,4)/t8-,10+;/m0./s1 |
| Standard InCHIKey: | XVPDSDYVNYOVMP-KXNXZCPBSA-N |
| Max Developmental Stage: | Approved |
| Max Developmental Stage Source: | ChEMBL |
Structural Similarity Between NPASS Natural Products and NPD311Similarity level is defined by Tanimoto coefficient (Tc) between two molecules. Tc lies between [0, 1] where '1' indicates the highest similarity. What is Tanimoto coefficient 
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.
Similar Natural Products High Similarity Level: Tc>=0.85; Intermediate Similarity Level: 0.7 <= Tc < 0.85; Remote Similarity Level: 0.65 <= Tc < 0.7