Drug Information| Drug ID:   | NPD310 |
| Drug Name:   | Pseudoephedrine Hydrochloride |
| Molecular Formula:   | C10H15NO.ClH |
| Canonical SMILES:   | CN[C@H]([C@H](c1ccccc1)O)C.Cl |
| Standard InCHI:   | "InChI=1S/C10H15NO.ClH/c1-8(11-2)10(12)9-6-4-3-5-7-9;/h3-8,10-12H,1-2H3;1H/t8-,10+;/m0./s1" |
| Standard InCHIKey:   | BALXUFOVQVENIU-KXNXZCPBSA-N |
| Max Developmental Stage:   | Approved |
| Max Developmental Stage Source:   | ChEMBL |
  Structural Similarity Between NPASS Natural Products and NPD310Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.
  Similar Natural Products High Similarity: Tc>=0.85; Intermediate Similarity: 0.7 <= Tc < 0.85; Remote Similarity: 0.5 <= Tc < 0.7
| Similarity Level | Similarity Score | Natural Product ID |
|---|---|---|
| High Similarity | 1.0 | NPC150254 |
| High Similarity | 0.96 | NPC147000 |
| High Similarity | 0.96 | NPC226778 |
| High Similarity | 0.96 | NPC304078 |
| High Similarity | 0.96 | NPC304761 |
| High Similarity | 0.96 | NPC286400 |
| High Similarity | 0.96 | NPC599866 |
| High Similarity | 0.96 | NPC606653 |
| High Similarity | 0.96 | NPC607075 |
| High Similarity | 0.96 | NPC611822 |
| Remote Similarity | 0.6429 | NPC164514 |
| Remote Similarity | 0.6429 | NPC303611 |
| Remote Similarity | 0.6429 | NPC108606 |
| Remote Similarity | 0.6429 | NPC199972 |
| Remote Similarity | 0.6429 | NPC603328 |
| Remote Similarity | 0.6429 | NPC611672 |
| Remote Similarity | 0.5385 | NPC103326 |
| Remote Similarity | 0.5385 | NPC99394 |
| Remote Similarity | 0.5385 | NPC87299 |
| TTD   | |
| DrugBank   | |
| ChEMBL   | |
| IUPHAR/BPS   | |
| PharmaGKB   | |
| KEGG Drug   | |
| PubChem CID   | 0 |
| ChEBI   | |
| CAS Number   |
| Molecular Weight   | 165.12 |
| ALogP   | -0.8279 |
| MLogP   | 2.34 |
| XLogP   | 2.52 |
| HDA   | 2 |
| HBD   | 2 |
| Rotatable Bonds   | 6 |
| TPSA   | 32.26 |
| RO5 Violation   | 0 |