Drug Information| Drug ID:   | NPD3096 |
| Drug Name:   | "glutathionarsenoxide, Cystemix" |
| Molecular Formula:   | C18H25AsN4O9S |
| Canonical SMILES:   | O=C(Nc1ccc(cc1)[As](O)O)CSC[C@@H](C(=NCC(=O)O)O)N=C(CC[C@@H](C(=O)O)N)O |
| Standard InCHI:   | "InChI=1S/C18H25AsN4O9S/c20-12(18(29)30)5-6-14(24)23-13(17(28)21-7-16(26)27)8-33-9-15(25)22-11-3-1-10(2-4-11)19(31)32/h1-4,12-13,31-32H,5-9,20H2,(H,21,28)(H,22,25)(H,23,24)(H,26,27)(H,29,30)/t12-,13-/m0/s1" |
| Standard InCHIKey:   | ADJQAKCDADMLPP-STQMWFEESA-N |
| Max Developmental Stage:   | Phase 2 |
| Max Developmental Stage Source:   | TTD |
  Structural Similarity Between NPASS Natural Products and NPD3096Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.
  Similar Natural Products High Similarity: Tc>=0.85; Intermediate Similarity: 0.7 <= Tc < 0.85; Remote Similarity: 0.5 <= Tc < 0.7
| Similarity Level | Similarity Score | Natural Product ID |
|---|---|---|
| Remote Similarity | 0.5493 | NPC250563 |
| Remote Similarity | 0.5385 | NPC108908 |
| Remote Similarity | 0.5072 | NPC126779 |
| Remote Similarity | 0.5072 | NPC168718 |
| Molecular Weight   | 548.06 |
| ALogP   | -3.3169 |
| MLogP   | 1.79 |
| XLogP   | -3.725 |
| HDA   | 13 |
| HBD   | 8 |
| Rotatable Bonds   | 22 |
| TPSA   | 260.66 |
| RO5 Violation   | 3 |