Drug Information| Drug ID:   | NPD3086 |
| Drug Name:   | Guadecitabine |
| Molecular Formula:   | C18H24N9O10P |
| Canonical SMILES:   | OC[C@H]1O[C@H](C[C@@H]1OP(=O)(OC[C@H]1O[C@H](C[C@@H]1O)n1cnc2c1[nH]c(=N)nc2O)O)n1cnc(=N)nc1O |
| Standard InCHI:   | "InChI=1S/C18H24N9O10P/c19-16-22-6-27(18(31)25-16)12-2-8(9(3-28)35-12)37-38(32,33)34-4-10-7(29)1-11(36-10)26-5-21-13-14(26)23-17(20)24-15(13)30/h5-12,28-29H,1-4H2,(H,32,33)(H2,19,25,31)(H3,20,23,24,30)/t7-,8-,9+,10+,11+,12+/m0/s1" |
| Standard InCHIKey:   | GUWXKKAWLCENJA-WGWHJZDNSA-N |
| Max Developmental Stage:   | Phase 3 |
| Max Developmental Stage Source:   | ChEMBL |
  Structural Similarity Between NPASS Natural Products and NPD3086Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.
  Similar Natural Products High Similarity: Tc>=0.85; Intermediate Similarity: 0.7 <= Tc < 0.85; Remote Similarity: 0.5 <= Tc < 0.7
| Similarity Level | Similarity Score | Natural Product ID |
|---|---|---|
| Intermediate Similarity | 0.7079 | NPC317746 |
| Remote Similarity | 0.6742 | NPC318590 |
| Remote Similarity | 0.6364 | NPC186619 |
| Remote Similarity | 0.5806 | NPC14590 |
| Remote Similarity | 0.5567 | NPC64705 |
| Remote Similarity | 0.5517 | NPC262926 |
| Remote Similarity | 0.5283 | NPC187707 |
| Remote Similarity | 0.5258 | NPC177169 |
| Remote Similarity | 0.5208 | NPC89147 |
| Remote Similarity | 0.5208 | NPC297033 |
| Remote Similarity | 0.5208 | NPC274384 |
| Remote Similarity | 0.5208 | NPC28366 |
| Remote Similarity | 0.52 | NPC232408 |
| TTD   | |
| DrugBank   | |
| ChEMBL   | |
| IUPHAR/BPS   | |
| PharmaGKB   | |
| KEGG Drug   | |
| PubChem CID   | 0 |
| ChEBI   | |
| CAS Number   |
| Molecular Weight   | 557.14 |
| ALogP   | -3.487 |
| MLogP   | 1.24 |
| XLogP   | -2.815 |
| HDA   | 19 |
| HBD   | 8 |
| Rotatable Bonds   | 13 |
| TPSA   | 282.82 |
| RO5 Violation   | 2 |