Drug Information| Drug ID:   | NPD3085 |
| Drug Name:   | S-110 |
| Molecular Formula:   | C18H24N9O10P |
| Canonical SMILES:   | OC[C@H]1O[C@H](C[C@@H]1OP(=O)(OC[C@H]1O[C@H](C[C@@H]1O)n1cnc2c1[nH]c(=N)nc2[O-])O)n1cnc(=N)nc1O |
| Standard InCHI:   | "InChI=1S/C18H24N9O10P/c19-16-22-6-27(18(31)25-16)12-2-8(9(3-28)35-12)37-38(32,33)34-4-10-7(29)1-11(36-10)26-5-21-13-14(26)23-17(20)24-15(13)30/h5-12,28-29H,1-4H2,(H,32,33)(H2,19,25,31)(H3,20,23,24,30)/p-1/t7-,8-,9+,10+,11+,12+/m0/s1" |
| Standard InCHIKey:   | GUWXKKAWLCENJA-WGWHJZDNSA-M |
| Max Developmental Stage:   | Phase 1 |
| Max Developmental Stage Source:   | TTD |
  Structural Similarity Between NPASS Natural Products and NPD3085Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.
| Molecular Weight   | 556.13 |
| ALogP   | -4.1648 |
| MLogP   | 1.24 |
| XLogP   | -2.815 |
| HDA   | 19 |
| HBD   | 7 |
| Rotatable Bonds   | 13 |
| TPSA   | 285.65 |
| RO5 Violation   | 2 |