NPASS drugs

Drug Information

Drug ID:	NPD3057
Drug Name:	Dihydrocodeine
Molecular Formula:	C18H23NO3
Canonical SMILES:	COc1ccc2c3c1O[C@@H]1[C@@]43CCN([C@H](C2)[C@@H]4CC[C@@H]1O)C
Standard InCHI:	"InChI=1S/C18H23NO3/c1-19-8-7-18-11-4-5-13(20)17(18)22-16-14(21-2)6-3-10(15(16)18)9-12(11)19/h3,6,11-13,17,20H,4-5,7-9H2,1-2H3/t11-,12+,13-,17-,18-/m0/s1"
Standard InCHIKey:	RBOXVHNMENFORY-DNJOTXNNSA-N
Max Developmental Stage:	Phase 4
Max Developmental Stage Source:	ChEMBL; IUPHAR/BPS

Structural Similarity Between NPASS Natural Products and NPD3057

Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.

Range	Similarity Score Range
0-0.1	64078
0.1-0.2	143619
0.2-0.3	3877
0.3-0.4	105
0.4-0.5	33
0.5-0.6	14
0.6-0.7	10
0.7-0.8	0
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	3

Similar Natural Products

High Similarity: Tc>=0.85; Intermediate Similarity: 0.7 <= Tc < 0.85; Remote Similarity: 0.5 <= Tc < 0.7

Similarity Level	Similarity Score	Natural Product ID
High Similarity	1.0	NPC305440
High Similarity	1.0	NPC67346
High Similarity	1.0	NPC599847
Remote Similarity	0.6866	NPC115906
Remote Similarity	0.6866	NPC608430
Remote Similarity	0.6812	NPC43069
Remote Similarity	0.6812	NPC235802
Remote Similarity	0.6812	NPC262786
Remote Similarity	0.6812	NPC163601
Remote Similarity	0.6812	NPC2073
Remote Similarity	0.6812	NPC319632
Remote Similarity	0.6812	NPC612004
Remote Similarity	0.6765	NPC97086
Remote Similarity	0.5946	NPC140577
Remote Similarity	0.5946	NPC146628
Remote Similarity	0.5867	NPC238919
Remote Similarity	0.5867	NPC70075
Remote Similarity	0.5833	NPC318674
Remote Similarity	0.5833	NPC214629
Remote Similarity	0.5833	NPC174783
Remote Similarity	0.5696	NPC44953
Remote Similarity	0.5676	NPC550752
Remote Similarity	0.5541	NPC327766
Remote Similarity	0.5541	NPC33179
Remote Similarity	0.5333	NPC581397
Remote Similarity	0.5111	NPC320999
Remote Similarity	0.5063	NPC311781

Drug Structure

NPD3057 OpenBabel08211702562D 23 27 0 0 1 0 0 0 0 0999 V2000 -4.0830 -1.6204 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.3650 2.8821 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.1724 1.6885 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.1724 -1.6889 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.4411 -2.1111 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.4411 2.1107 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.1724 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.6350 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.9037 0.4218 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.1724 0.8440 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.1724 -0.8445 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 -2.9037 -0.4222 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 -0.7098 -1.6889 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 -0.7098 1.6885 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.4411 0.4218 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.7098 0.8440 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.7098 -0.8445 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 -1.4411 -0.4222 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 -3.6350 -0.8445 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 0.0215 -2.1111 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 0.0215 2.1107 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 0.0000 -0.0000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 0.7177 -1.6332 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 1 19 1 0 0 0 0 2 21 1 0 0 0 0 3 6 2 0 0 0 0 3 10 1 0 0 0 0 4 5 1 0 0 0 0 4 11 1 0 0 0 0 5 13 1 0 0 0 0 6 14 1 0 0 0 0 7 8 1 0 0 0 0 8 19 1 0 0 0 0 9 10 1 0 0 0 0 10 15 2 0 0 0 0 11 12 1 0 0 0 0 11 18 1 1 0 0 0 12 9 1 6 0 0 0 12 19 1 0 0 0 0 13 17 1 0 0 0 0 13 20 1 1 0 0 0 14 16 2 0 0 0 0 14 21 1 0 0 0 0 15 16 1 0 0 0 0 15 18 1 0 0 0 0 16 22 1 0 0 0 0 17 18 1 1 0 0 0 17 22 1 0 0 0 0 18 7 1 6 0 0 0 20 23 1 0 0 0 0 M END $$$$

External Identifiers

TTD	DIB015600
DrugBank	DB01551
ChEMBL	CHEMBL1595
IUPHAR/BPS	7594
PharmaGKB	PA449322
KEGG Drug	D01481
PubChem CID	5284543
ChEBI	135276
CAS Number	125-28-0

Drug Properties

Molecular Weight	301.17
ALogP	-0.962
MLogP	3
XLogP	0.687
HDA	4
HBD	1
Rotatable Bonds	4
TPSA	41.93
RO5 Violation	0