NPASS drugs

Drug Information

Drug ID:	NPD2965
Drug Name:
Molecular Formula:	C18H21N5O4
Canonical SMILES:	OC[C@H]1O[C@H]([C@@H]([C@@H]1O)O)n1cnc2c1ncnc2NCc1ccccc1C
Standard InCHI:	"InChI=1S/C18H21N5O4/c1-10-4-2-3-5-11(10)6-19-16-13-17(21-8-20-16)23(9-22-13)18-15(26)14(25)12(7-24)27-18/h2-5,8-9,12,14-15,18,24-26H,6-7H2,1H3,(H,19,20,21)/t12-,14-,15-,18-/m1/s1"
Standard InCHIKey:	OOEMZCZWZXHBKW-SCFUHWHPSA-N
Max Developmental Stage:	Phase 2
Max Developmental Stage Source:	TTD

Structural Similarity Between NPASS Natural Products and NPD2965

Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.

Range	Similarity Score Range
0-0.1	119926
0.1-0.2	90436
0.2-0.3	938
0.3-0.4	249
0.4-0.5	138
0.5-0.6	18
0.6-0.7	24
0.7-0.8	3
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similar Natural Products

High Similarity: Tc>=0.85; Intermediate Similarity: 0.7 <= Tc < 0.85; Remote Similarity: 0.5 <= Tc < 0.7

Similarity Level	Similarity Score	Natural Product ID
Intermediate Similarity	0.7397	NPC584312
Intermediate Similarity	0.7324	NPC250178
Intermediate Similarity	0.7324	NPC604295
Remote Similarity	0.6716	NPC7092
Remote Similarity	0.6389	NPC552222
Remote Similarity	0.6389	NPC598126
Remote Similarity	0.6282	NPC102777
Remote Similarity	0.625	NPC239737
Remote Similarity	0.625	NPC165007
Remote Similarity	0.625	NPC145558
Remote Similarity	0.625	NPC528862
Remote Similarity	0.6212	NPC156461
Remote Similarity	0.6212	NPC322476
Remote Similarity	0.6212	NPC107374
Remote Similarity	0.6212	NPC2499
Remote Similarity	0.6212	NPC532382
Remote Similarity	0.6212	NPC584269
Remote Similarity	0.6212	NPC600382
Remote Similarity	0.6212	NPC605359
Remote Similarity	0.6212	NPC609539
Remote Similarity	0.6212	NPC612067
Remote Similarity	0.6081	NPC27600
Remote Similarity	0.6081	NPC261323
Remote Similarity	0.6081	NPC527816
Remote Similarity	0.6081	NPC578146
Remote Similarity	0.6	NPC525371
Remote Similarity	0.6	NPC558653
Remote Similarity	0.5844	NPC40958
Remote Similarity	0.5584	NPC541250
Remote Similarity	0.5584	NPC570461
Remote Similarity	0.5488	NPC567958
Remote Similarity	0.5443	NPC132492
Remote Similarity	0.5443	NPC329209
Remote Similarity	0.5422	NPC283520
Remote Similarity	0.5405	NPC519006
Remote Similarity	0.5405	NPC605318
Remote Similarity	0.5341	NPC542905
Remote Similarity	0.5227	NPC493952
Remote Similarity	0.5217	NPC317821
Remote Similarity	0.5135	NPC136349
Remote Similarity	0.5135	NPC219313
Remote Similarity	0.5135	NPC525749
Remote Similarity	0.5125	NPC195140
Remote Similarity	0.5114	NPC512727
Remote Similarity	0.5114	NPC517687

Drug Structure

NPD2965 OpenBabel08211702562D 31 34 0 0 1 0 0 0 0 0999 V2000 7.3242 -0.5477 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 5.5921 -2.5477 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.7261 -2.0477 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 6.4582 -2.0477 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.7261 -1.0477 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 5.5921 0.4523 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.6637 -0.6386 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.9941 -1.0477 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.7916 2.0350 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 6.4582 -1.0477 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 5.5921 -0.5477 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.9945 0.1045 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 2.9941 0.9523 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.2024 1.0827 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 -0.3364 1.5827 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 3.8601 0.4523 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.1280 0.4523 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.4067 0.9135 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 4.7261 0.9523 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 3.8601 -0.5477 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 2.1280 -0.5477 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 2.7861 1.9305 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 1.3849 1.1215 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 -2.6418 -0.4307 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -2.1160 1.4894 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -0.2319 2.5772 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 0.0000 -0.0000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 4.7261 1.9523 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.9508 0.5204 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.2205 2.4839 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.0409 3.1650 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 1 10 1 0 0 0 0 2 3 2 0 0 0 0 2 4 1 0 0 0 0 3 5 1 0 0 0 0 4 10 2 0 0 0 0 5 11 2 0 0 0 0 6 11 1 0 0 0 0 6 19 1 0 0 0 0 7 24 1 0 0 0 0 8 20 2 0 0 0 0 8 21 1 0 0 0 0 9 22 2 0 0 0 0 9 23 1 0 0 0 0 10 11 1 0 0 0 0 12 7 1 6 0 0 0 12 14 1 0 0 0 0 12 27 1 0 0 0 0 13 16 2 0 0 0 0 13 17 1 0 0 0 0 13 22 1 0 0 0 0 14 15 1 0 0 0 0 14 25 1 1 0 0 0 15 18 1 0 0 0 0 15 26 1 1 0 0 0 16 19 1 0 0 0 0 16 20 1 0 0 0 0 17 21 2 0 0 0 0 17 23 1 0 0 0 0 18 23 1 6 0 0 0 18 27 1 0 0 0 0 19 28 1 0 0 0 0 24 29 1 0 0 0 0 25 30 1 0 0 0 0 26 31 1 0 0 0 0 M END $$$$

External Identifiers

TTD	DNC005663
DrugBank
ChEMBL
IUPHAR/BPS
PharmaGKB
KEGG Drug
PubChem CID	65710
ChEBI
CAS Number

Drug Properties

Molecular Weight	371.16
ALogP	-1.296
MLogP	2.45
XLogP	1.812
HDA	9
HBD	4
Rotatable Bonds	9
TPSA	125.55
RO5 Violation	0