Drug Information| Drug ID:   | NPD296 |
| Drug Name:   | Methamphetamine |
| Molecular Formula:   | C10H15N |
| Canonical SMILES:   | CN[C@H](Cc1ccccc1)C |
| Standard InCHI:   | "InChI=1S/C10H15N/c1-9(11-2)8-10-6-4-3-5-7-10/h3-7,9,11H,8H2,1-2H3/t9-/m0/s1" |
| Standard InCHIKey:   | MYWUZJCMWCOHBA-VIFPVBQESA-N |
| Max Developmental Stage:   | Phase 4 |
| Max Developmental Stage Source:   | ChEMBL |
  Structural Similarity Between NPASS Natural Products and NPD296Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.
  Similar Natural Products High Similarity: Tc>=0.85; Intermediate Similarity: 0.7 <= Tc < 0.85; Remote Similarity: 0.5 <= Tc < 0.7
| Similarity Level | Similarity Score | Natural Product ID |
|---|---|---|
| High Similarity | 1.0 | NPC581920 |
| High Similarity | 1.0 | NPC608468 |
| Remote Similarity | 0.6667 | NPC112609 |
| Remote Similarity | 0.6667 | NPC515509 |
| Remote Similarity | 0.6667 | NPC599831 |
| Remote Similarity | 0.6667 | NPC612027 |
| Remote Similarity | 0.6 | NPC534707 |
| Remote Similarity | 0.6 | NPC541757 |
| Remote Similarity | 0.5714 | NPC562106 |
| Remote Similarity | 0.5714 | NPC601867 |
| Remote Similarity | 0.5455 | NPC65873 |
| Remote Similarity | 0.5455 | NPC155369 |
| Remote Similarity | 0.5455 | NPC561991 |
| TTD   | DAP000573; DAP001496 |
| DrugBank   | DB01577 |
| ChEMBL   | CHEMBL1201201 |
| IUPHAR/BPS   | |
| PharmaGKB   | PA450403 |
| KEGG Drug   | |
| PubChem CID   | 10836 |
| ChEBI   | 6809 |
| CAS Number   | 537-46-2 |
| Molecular Weight   | 149.12 |
| ALogP   | -0.2548 |
| MLogP   | 2.45 |
| XLogP   | 3.972 |
| HDA   | 1 |
| HBD   | 1 |
| Rotatable Bonds   | 5 |
| TPSA   | 12.03 |
| RO5 Violation   | 0 |