Drug Information| Drug ID: | NPD295 |
| Drug Name: | methamphetamine |
| Molecular Formula: | C10H15N |
| Canonical SMILES: | CNC(Cc1ccccc1)C |
| Standard InCHI: | "InChI=1S/C10H15N/c1-9(11-2)8-10-6-4-3-5-7-10/h3-7,9,11H,8H2,1-2H3" |
| Standard InCHIKey: | MYWUZJCMWCOHBA-UHFFFAOYSA-N |
| Max Developmental Stage: | Approved |
| Max Developmental Stage Source: | IUPHAR/BPS |
Structural Similarity Between NPASS Natural Products and NPD295Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.
Similar Natural Products High Similarity: Tc>=0.85; Intermediate Similarity: 0.7 <= Tc < 0.85; Remote Similarity: 0.5 <= Tc < 0.7
| Similarity Level | Similarity Score | Natural Product ID |
|---|---|---|
| High Similarity | 1.0 | NPC581920 |
| High Similarity | 1.0 | NPC608468 |
| Remote Similarity | 0.6667 | NPC112609 |
| Remote Similarity | 0.6667 | NPC515509 |
| Remote Similarity | 0.6667 | NPC599831 |
| Remote Similarity | 0.6667 | NPC612027 |
| Remote Similarity | 0.6 | NPC534707 |
| Remote Similarity | 0.6 | NPC541757 |
| Remote Similarity | 0.5714 | NPC562106 |
| Remote Similarity | 0.5714 | NPC601867 |
| Remote Similarity | 0.5455 | NPC65873 |
| Remote Similarity | 0.5455 | NPC155369 |
| Remote Similarity | 0.5455 | NPC561991 |