Drug Information| Drug ID:   | NPD293 |
| Drug Name:   | Methamphetamine Hydrochloride |
| Molecular Formula:   | C10H15N.ClH |
| Canonical SMILES:   | CN[C@H](Cc1ccccc1)C.Cl |
| Standard InCHI:   | "InChI=1S/C10H15N.ClH/c1-9(11-2)8-10-6-4-3-5-7-10;/h3-7,9,11H,8H2,1-2H3;1H/t9-;/m0./s1" |
| Standard InCHIKey:   | TWXDDNPPQUTEOV-FVGYRXGTSA-N |
| Max Developmental Stage:   | Approved |
| Max Developmental Stage Source:   | ChEMBL |
  Structural Similarity Between NPASS Natural Products and NPD293Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.
  Similar Natural Products High Similarity: Tc>=0.85; Intermediate Similarity: 0.7 <= Tc < 0.85; Remote Similarity: 0.5 <= Tc < 0.7
| Similarity Level | Similarity Score | Natural Product ID |
|---|---|---|
| High Similarity | 0.9545 | NPC581920 |
| High Similarity | 0.9545 | NPC608468 |
| Remote Similarity | 0.64 | NPC112609 |
| Remote Similarity | 0.64 | NPC515509 |
| Remote Similarity | 0.64 | NPC599831 |
| Remote Similarity | 0.64 | NPC612027 |
| Remote Similarity | 0.5806 | NPC534707 |
| Remote Similarity | 0.5806 | NPC541757 |
| Remote Similarity | 0.5517 | NPC562106 |
| Remote Similarity | 0.5517 | NPC601867 |
| Remote Similarity | 0.5294 | NPC561991 |
| Remote Similarity | 0.5217 | NPC65873 |
| Remote Similarity | 0.5217 | NPC155369 |
| TTD   | |
| DrugBank   | |
| ChEMBL   | |
| IUPHAR/BPS   | |
| PharmaGKB   | |
| KEGG Drug   | |
| PubChem CID   | 0 |
| ChEBI   | |
| CAS Number   |
| Molecular Weight   | 149.12 |
| ALogP   | -0.2548 |
| MLogP   | 2.45 |
| XLogP   | 3.972 |
| HDA   | 1 |
| HBD   | 1 |
| Rotatable Bonds   | 5 |
| TPSA   | 12.03 |
| RO5 Violation   | 0 |