Drug Information| Drug ID:   | NPD291 |
| Drug Name:   | Guaifenesin |
| Molecular Formula:   | C10H14O4 |
| Canonical SMILES:   | OCC(COc1ccccc1OC)O |
| Standard InCHI:   | "InChI=1S/C10H14O4/c1-13-9-4-2-3-5-10(9)14-7-8(12)6-11/h2-5,8,11-12H,6-7H2,1H3" |
| Standard InCHIKey:   | HSRJKNPTNIJEKV-UHFFFAOYSA-N |
| Max Developmental Stage:   | Phase 4 |
| Max Developmental Stage Source:   | ChEMBL; IUPHAR/BPS |
  Structural Similarity Between NPASS Natural Products and NPD291Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.
  Similar Natural Products High Similarity: Tc>=0.85; Intermediate Similarity: 0.7 <= Tc < 0.85; Remote Similarity: 0.5 <= Tc < 0.7
| Similarity Level | Similarity Score | Natural Product ID |
|---|---|---|
| Remote Similarity | 0.5714 | NPC194034 |
| Remote Similarity | 0.5714 | NPC600713 |
| Remote Similarity | 0.56 | NPC206876 |
| Remote Similarity | 0.5455 | NPC76849 |
| Molecular Weight   | 198.09 |
| ALogP   | -1.1537 |
| MLogP   | 2.12 |
| XLogP   | 0.527 |
| HDA   | 2 |
| HBD   | 2 |
| Rotatable Bonds   | 8 |
| TPSA   | 58.92 |
| RO5 Violation   | 0 |