Drug Information| Drug ID:   | NPD2902 |
| Drug Name:   | Sonedenoson |
| Molecular Formula:   | C18H20ClN5O5 |
| Canonical SMILES:   | OC[C@H]1O[C@H]([C@@H]([C@@H]1O)O)n1cnc2c1nc(OCCc1ccc(cc1)Cl)nc2N |
| Standard InCHI:   | "InChI=1S/C18H20ClN5O5/c19-10-3-1-9(2-4-10)5-6-28-18-22-15(20)12-16(23-18)24(8-21-12)17-14(27)13(26)11(7-25)29-17/h1-4,8,11,13-14,17,25-27H,5-7H2,(H2,20,22,23)/t11-,13-,14-,17-/m1/s1" |
| Standard InCHIKey:   | WUCQGGOGHZRELS-LSCFUAHRSA-N |
| Max Developmental Stage:   | Phase 2 |
| Max Developmental Stage Source:   | ChEMBL |
  Structural Similarity Between NPASS Natural Products and NPD2902Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.
| TTD   | |
| DrugBank   | |
| ChEMBL   | |
| IUPHAR/BPS   | |
| PharmaGKB   | |
| KEGG Drug   | |
| PubChem CID   | 0 |
| ChEBI   | |
| CAS Number   |
| Molecular Weight   | 421.12 |
| ALogP   | -1.4217 |
| MLogP   | 2.23 |
| XLogP   | 0.971 |
| HDA   | 9 |
| HBD   | 4 |
| Rotatable Bonds   | 11 |
| TPSA   | 148.77 |
| RO5 Violation   | 0 |