NPASS drugs

Drug Information

Drug ID:	NPD2891
Drug Name:	Cephaloglycin
Molecular Formula:	C18H19N3O6S
Canonical SMILES:	CC(=O)OCC1=C(C(=O)O)N2[C@H](SC1)[C@@H](C2=O)N=C([C@@H](c1ccccc1)N)O
Standard InCHI:	"InChI=1S/C18H19N3O6S/c1-9(22)27-7-11-8-28-17-13(16(24)21(17)14(11)18(25)26)20-15(23)12(19)10-5-3-2-4-6-10/h2-6,12-13,17H,7-8,19H2,1H3,(H,20,23)(H,25,26)/t12-,13-,17-/m1/s1"
Standard InCHIKey:	FUBBGQLTSCSAON-PBFPGSCMSA-N
Max Developmental Stage:	Phase 4
Max Developmental Stage Source:	ChEMBL

Structural Similarity Between NPASS Natural Products and NPD2891

Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.

Range	Similarity Score Range
0-0.1	73840
0.1-0.2	134070
0.2-0.3	3777
0.3-0.4	31
0.4-0.5	12
0.5-0.6	9
0.6-0.7	0
0.7-0.8	0
0.8-0.85	1
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similar Natural Products

High Similarity: Tc>=0.85; Intermediate Similarity: 0.7 <= Tc < 0.85; Remote Similarity: 0.5 <= Tc < 0.7

Similarity Level	Similarity Score	Natural Product ID
Intermediate Similarity	0.8197	NPC13470
Remote Similarity	0.5972	NPC270750
Remote Similarity	0.5972	NPC165659
Remote Similarity	0.5897	NPC478434
Remote Similarity	0.5857	NPC157603
Remote Similarity	0.5775	NPC64758
Remote Similarity	0.5658	NPC487959
Remote Similarity	0.5513	NPC481259
Remote Similarity	0.5493	NPC468984
Remote Similarity	0.5244	NPC483027

Drug Structure

NPD2891 OpenBabel08211702562D 32 34 0 0 1 0 0 0 0 0999 V2000 -5.3301 -1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 5.2779 -1.3789 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.5708 -0.6718 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 5.0191 -2.3449 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.6049 -0.9306 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.0532 -2.6037 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.5981 0.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.7321 -1.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.4641 -1.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.3461 -1.8966 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.7321 -0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.3801 -2.1554 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 -0.0000 -1.0000 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 -1.8660 0.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.6730 -1.4483 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.0000 -0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.0000 -1.0000 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 -1.8660 1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.1213 -3.1213 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 0.7071 -1.7071 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 -1.0000 0.0000 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 -3.5981 -1.5000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 1.9319 -0.4824 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 0.7071 0.7071 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -2.7321 2.0000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -1.0000 2.0000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.4641 0.0000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -1.8660 -1.5000 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0 2.8284 -3.8284 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 1.1554 -3.3801 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 2.8978 -0.2235 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.0000 3.0000 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 1 9 1 0 0 0 0 2 3 2 0 0 0 0 2 4 1 0 0 0 0 3 5 1 0 0 0 0 4 6 2 0 0 0 0 5 10 2 0 0 0 0 6 10 1 0 0 0 0 7 11 1 0 0 0 0 7 27 1 0 0 0 0 8 11 1 0 0 0 0 8 28 1 0 0 0 0 9 22 2 0 0 0 0 9 27 1 0 0 0 0 10 12 1 0 0 0 0 11 14 2 0 0 0 0 12 15 1 1 0 0 0 12 19 1 0 0 0 0 13 16 1 0 0 0 0 13 17 1 0 0 0 0 13 20 1 1 0 0 0 14 18 1 0 0 0 0 14 21 1 0 0 0 0 15 20 2 3 0 0 0 15 23 1 0 0 0 0 16 21 1 0 0 0 0 16 24 2 0 0 0 0 17 21 1 0 0 0 0 17 28 1 1 0 0 0 18 25 2 0 0 0 0 18 26 1 0 0 0 0 19 29 1 0 0 0 0 19 30 1 0 0 0 0 23 31 1 0 0 0 0 26 32 1 0 0 0 0 M END $$$$

External Identifiers

TTD	DAP001158
DrugBank	DB00689
ChEMBL	CHEMBL1200971
IUPHAR/BPS
PharmaGKB	PA164781027
KEGG Drug	D01949
PubChem CID	19150
ChEBI	34613
CAS Number

Drug Properties

Molecular Weight	405.1
ALogP	-1.5301
MLogP	2.34
XLogP	-1.302
HDA	9
HBD	3
Rotatable Bonds	11
TPSA	167.82
RO5 Violation	0