Drug Information| Drug ID:   | NPD2888 |
| Drug Name:   | Cefprozil |
| Molecular Formula:   | C18H19N3O5S.H2O |
| Canonical SMILES:   | CC=CC1=C(C(=O)O)N2[C@H](SC1)[C@@H](C2=O)N=C([C@@H](c1ccc(cc1)O)N)O.O |
| Standard InCHI:   | "InChI=1S/C18H19N3O5S.H2O/c1-2-3-10-8-27-17-13(16(24)21(17)14(10)18(25)26)20-15(23)12(19)9-4-6-11(22)7-5-9;/h2-7,12-13,17,22H,8,19H2,1H3,(H,20,23)(H,25,26);1H2/t12-,13-,17-;/m1./s1" |
| Standard InCHIKey:   | ALYUMNAHLSSTOU-PFBPGKLMSA-N |
| Max Developmental Stage:   | Approved |
| Max Developmental Stage Source:   | ChEMBL |
  Structural Similarity Between NPASS Natural Products and NPD2888Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.
| TTD   | |
| DrugBank   | |
| ChEMBL   | |
| IUPHAR/BPS   | |
| PharmaGKB   | |
| KEGG Drug   | |
| PubChem CID   | 0 |
| ChEBI   | |
| CAS Number   |
| Molecular Weight   | 389.1 |
| ALogP   | -1.0135 |
| MLogP   | 2.45 |
| XLogP   | -1.577 |
| HDA   | 7 |
| HBD   | 4 |
| Rotatable Bonds   | 10 |
| TPSA   | 161.75 |
| RO5 Violation   | 0 |