Drug Information| Drug ID:   | NPD2876 |
| Drug Name:   | Ib-Meca |
| Molecular Formula:   | C18H19IN6O4 |
| Canonical SMILES:   | CN=C([C@H]1O[C@H]([C@@H]([C@@H]1O)O)n1cnc2c1ncnc2NCc1cccc(c1)I)O |
| Standard InCHI:   | "InChI=1S/C18H19IN6O4/c1-20-17(28)14-12(26)13(27)18(29-14)25-8-24-11-15(22-7-23-16(11)25)21-6-9-3-2-4-10(19)5-9/h2-5,7-8,12-14,18,26-27H,6H2,1H3,(H,20,28)(H,21,22,23)/t12-,13+,14-,18+/m0/s1" |
| Standard InCHIKey:   | HUJXGQILHAUCCV-MOROJQBDSA-N |
| Max Developmental Stage:   | Phase 3 |
| Max Developmental Stage Source:   | ChEMBL |
  Structural Similarity Between NPASS Natural Products and NPD2876Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.
  Similar Natural Products High Similarity: Tc>=0.85; Intermediate Similarity: 0.7 <= Tc < 0.85; Remote Similarity: 0.5 <= Tc < 0.7
| Similarity Level | Similarity Score | Natural Product ID |
|---|---|---|
| Remote Similarity | 0.5882 | NPC250178 |
| Remote Similarity | 0.5882 | NPC604295 |
| Remote Similarity | 0.5618 | NPC584312 |
| Remote Similarity | 0.5122 | NPC7092 |
| TTD   | DNC000764 |
| DrugBank   | DB05511 |
| ChEMBL   | CHEMBL119709 |
| IUPHAR/BPS   | |
| PharmaGKB   | |
| KEGG Drug   | |
| PubChem CID   | 123683 |
| ChEBI   | 73286 |
| CAS Number   | 152918-18-8 |
| Molecular Weight   | 510.05 |
| ALogP   | -0.4915 |
| MLogP   | 2.23 |
| XLogP   | 2.021 |
| HDA   | 10 |
| HBD   | 4 |
| Rotatable Bonds   | 10 |
| TPSA   | 137.91 |
| RO5 Violation   | 0 |