NPASS drugs

Drug Information

Drug ID:	NPD2828
Drug Name:	Clothiapine
Molecular Formula:	C18H18ClN3S
Canonical SMILES:	CN1CCN(CC1)C1=Nc2ccccc2Sc2c1cc(Cl)cc2
Standard InCHI:	InChI=1S/C18H18ClN3S/c1-21-8-10-22(11-9-21)18-14-12-13(19)6-7-16(14)23-17-5-3-2-4-15(17)20-18/h2-7,12H,8-11H2,1H3
Standard InCHIKey:	KAAZGXDPUNNEFN-UHFFFAOYSA-N
Max Developmental Stage:	Approved
Max Developmental Stage Source:	ChEMBL

Structural Similarity Between NPASS Natural Products and NPD2828

Similarity level is defined by Tanimoto coefficient (Tc) between two molecules. Tc lies between [0, 1] where '1' indicates the highest similarity. What is Tanimoto coefficient
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.

Range	Similarity Score Range
0-0.1	788
0.1-0.2	10033
0.2-0.3	13080
0.3-0.4	4687
0.4-0.5	2039
0.5-0.6	246
0.6-0.7	16
0.7-0.8	1
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similar Natural Products

High Similarity Level: Tc>=0.85; Intermediate Similarity Level: 0.7 <= Tc < 0.85; Remote Similarity Level: 0.65 <= Tc < 0.7

Show entries

Search:

Similarity Level	Similarity Score	Natural Product ID
Intermediate Similarity	0.7961	NPC321617
Remote Similarity	0.6954	NPC473417
Remote Similarity	0.6903	NPC325599
Remote Similarity	0.6577	NPC317564
Remote Similarity	0.6575	NPC288232
Remote Similarity	0.6357	NPC291610
Remote Similarity	0.6327	NPC296163
Remote Similarity	0.6319	NPC164802
Remote Similarity	0.6267	NPC192209
Remote Similarity	0.625	NPC313352

Showing 1 to 10 of 40 entries

Previous1 2 3 4Next

Drug Structure

NPD2828 OpenBabel08211702552D 23 26 0 0 0 0 0 0 0 0999 V2000 4.5025 0.4460 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.4283 0.9010 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.9916 0.0747 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.4311 0.8262 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.5577 -0.8262 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.5311 -3.7219 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.3349 -3.2219 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.3244 -0.8237 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.8138 0.8314 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.3688 -1.1185 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.8583 0.5366 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.3972 -2.2219 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.3972 -3.2219 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.5311 -1.7219 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.9972 -0.0747 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.3349 -2.2219 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.5605 -0.9010 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.6802 -0.7331 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.2632 -3.7219 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0 0.0000 -0.0000 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 3.5469 0.1512 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 1.6357 -0.4383 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 -1.2658 -1.8565 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0 1 21 1 0 0 0 0 2 3 2 0 0 0 0 2 4 1 0 0 0 0 3 5 1 0 0 0 0 4 15 2 0 0 0 0 5 17 2 0 0 0 0 6 7 2 0 0 0 0 6 13 1 0 0 0 0 7 16 1 0 0 0 0 8 10 1 0 0 0 0 8 21 1 0 0 0 0 9 11 1 0 0 0 0 9 21 1 0 0 0 0 10 22 1 0 0 0 0 11 22 1 0 0 0 0 12 13 2 0 0 0 0 12 14 1 0 0 0 0 13 19 1 0 0 0 0 14 16 2 0 0 0 0 14 18 1 0 0 0 0 15 17 1 0 0 0 0 15 20 1 0 0 0 0 16 23 1 0 0 0 0 17 23 1 0 0 0 0 18 20 2 0 0 0 0 18 22 1 0 0 0 0 M END $$$$

External Identifiers

TTD	DIB001176
DrugBank
ChEMBL
IUPHAR/BPS
PharmaGKB
KEGG Drug
PubChem CID
ChEBI
CAS Number

Drug Properties

Molecular Weight	343.09
ALogP	1.0202
MLogP	2.89
XLogP	4.639
HDA	3
HBD	0
Rotatable Bonds	3
TPSA	44.14
RO5 Violation	0