Drug Information| Drug ID:   | NPD280 |
| Drug Name:   | Telbivudine |
| Molecular Formula:   | C10H14N2O5 |
| Canonical SMILES:   | OC[C@@H]1O[C@@H](C[C@H]1O)n1cc(C)c(nc1=O)O |
| Standard InCHI:   | "InChI=1S/C10H14N2O5/c1-5-3-12(10(16)11-9(5)15)8-2-6(14)7(4-13)17-8/h3,6-8,13-14H,2,4H2,1H3,(H,11,15,16)/t6-,7+,8+/m1/s1" |
| Standard InCHIKey:   | IQFYYKKMVGJFEH-CSMHCCOUSA-N |
| Max Developmental Stage:   | Phase 4 |
| Max Developmental Stage Source:   | ChEMBL |
  Structural Similarity Between NPASS Natural Products and NPD280Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.
  Similar Natural Products High Similarity: Tc>=0.85; Intermediate Similarity: 0.7 <= Tc < 0.85; Remote Similarity: 0.5 <= Tc < 0.7
| Similarity Level | Similarity Score | Natural Product ID |
|---|---|---|
| High Similarity | 1.0 | NPC71339 |
| Remote Similarity | 0.6786 | NPC327344 |
| Remote Similarity | 0.6731 | NPC117529 |
| Remote Similarity | 0.6667 | NPC163352 |
| Remote Similarity | 0.6667 | NPC210456 |
| Remote Similarity | 0.625 | NPC171116 |
| Remote Similarity | 0.6154 | NPC106780 |
| Remote Similarity | 0.614 | NPC478793 |
| Remote Similarity | 0.6111 | NPC478862 |
| Remote Similarity | 0.5938 | NPC318166 |
| Remote Similarity | 0.5556 | NPC538001 |
| Remote Similarity | 0.5556 | NPC604300 |
| Remote Similarity | 0.5273 | NPC604455 |
| Remote Similarity | 0.5273 | NPC611237 |
| Remote Similarity | 0.5172 | NPC494980 |
| Remote Similarity | 0.5172 | NPC560680 |
| TTD   | DAP000698 |
| DrugBank   | DB01265 |
| ChEMBL   | CHEMBL374731 |
| IUPHAR/BPS   | |
| PharmaGKB   | PA164760861 |
| KEGG Drug   | |
| PubChem CID   | 159269 |
| ChEBI   | 63624 |
| CAS Number   | 3424-98-4 |
| Molecular Weight   | 242.09 |
| ALogP   | -1.7707 |
| MLogP   | 1.79 |
| XLogP   | -1 |
| HDA   | 7 |
| HBD   | 3 |
| Rotatable Bonds   | 6 |
| TPSA   | 102.59 |
| RO5 Violation   | 0 |